Difference between revisions of "Tiso gene 787"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] == * smiles: ** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
(Created page with "Category:Gene == Gene Tiso_gene_787 == * Synonym(s): == Reactions associated == * Reaction: RXN0-5419 ** Source: orthology-esiliculosus == Pathways associated ==...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Gene]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17347 CPD-17347] ==
+
== Gene Tiso_gene_787 ==
* smiles:
+
** CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
+
* inchi key:
+
** InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J
+
* common name:
+
** (3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA
+
* molecular weight:
+
** 1069.99   
+
 
* Synonym(s):
 
* Synonym(s):
** (3R)-hydroxy-20:2Δ11,14
 
  
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
* [[RXN-16096]]
+
* Reaction: [[RXN0-5419]]
== Reaction(s) known to produce the compound ==
+
** Source: [[orthology-esiliculosus]]
* [[RXN-16095]]
+
== Pathways associated ==
== Reaction(s) of unknown directionality ==
+
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: reaction associated=RXN0-5419}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=72193805 72193805]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76408 76408]
+
{{#set: smiles=CCCCCC=CCC=CCCCCCCCC(O)CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
+
{{#set: inchi key=InChIKey=MNTSLNSVZACNCX-JPDDAYGWSA-J}}
+
{{#set: common name=(3R)-hydroxy-(11Z,14Z)-icosa-11,14-dienoyl-CoA}}
+
{{#set: molecular weight=1069.99    }}
+
{{#set: common name=(3R)-hydroxy-20:2Δ11,14}}
+
{{#set: consumed by=RXN-16096}}
+
{{#set: produced by=RXN-16095}}
+

Latest revision as of 19:55, 21 March 2018

Gene Tiso_gene_787

  • Synonym(s):

Reactions associated

Pathways associated

External links