Difference between revisions of "Tiso gene 12635"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] == * smiles: ** CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])...")
 
(Created page with "Category:Gene == Gene Tiso_gene_12635 == * right end position: ** 2631 * transcription direction: ** POSITIVE * left end position: ** 601 * centisome position: ** 8.825256...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-13533 CPD-13533] ==
+
== Gene Tiso_gene_12635 ==
−
* smiles:
+
* right end position:
−
** CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O
+
** 2631
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YYGYPCRWZMLSGK-ORUMCERNSA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** (R)-3-hydroxyvaleryl-CoA
+
** 601
−
* molecular weight:
+
* centisome position:
−
** 863.619    
+
** 8.825256    
 
* Synonym(s):
 
* Synonym(s):
−
** D-β-hydroxyvaleryl-CoA
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[annotation-in-silico_annotation]]
−
* [[RXN-12560]]
+
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2631}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=54758578 54758578]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=CCC(CC(SCCNC(CCNC(C(C(COP(=O)([O-])OP(OCC1(OC(C(C1OP([O-])([O-])=O)O)N3(C=NC2(C(=NC=NC=23)N))))([O-])=O)(C)C)O)=O)=O)=O)O}}
+
{{#set: left end position=601}}
−
{{#set: inchi key=InChIKey=YYGYPCRWZMLSGK-ORUMCERNSA-J}}
+
{{#set: centisome position=8.825256   }}
−
{{#set: common name=(R)-3-hydroxyvaleryl-CoA}}
+
{{#set: reaction associated=TRNA-PSEUDOURIDINE-SYNTHASE-I-RXN}}
−
{{#set: molecular weight=863.619   }}
+
−
{{#set: common name=D-β-hydroxyvaleryl-CoA}}
+
−
{{#set: consumed or produced by=RXN-12560}}
+

Latest revision as of 19:55, 21 March 2018

Gene Tiso_gene_12635

  • right end position:
    • 2631
  • transcription direction:
    • POSITIVE
  • left end position:
    • 601
  • centisome position:
    • 8.825256
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12635&oldid=44621"