Difference between revisions of "CPD-8610"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_9959 == * left end position: ** 3005 * transcription direction: ** POSITIVE * right end position: ** 7954 * centisome position: ** 33.59419...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == * smiles: ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C...") |
||
| (3 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8610 CPD-8610] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C |
| − | * | + | * common name: |
| − | ** | + | ** 4,4-dimethyl-5α-cholesta-8-en-3-β-ol |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N |
| − | * | + | * molecular weight: |
| − | ** | + | ** 414.713 |
* Synonym(s): | * Synonym(s): | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | * [[RXN66-14]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | + | * PUBCHEM: | |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=12070223 12070223] |
| − | {{#set: | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10474091.html 10474091] |
| − | {{#set: | + | * HMDB : HMDB06840 |
| − | {{#set: | + | * LIGAND-CPD: |
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15915 C15915] | ||
| + | {{#set: smiles=CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C}} | ||
| + | {{#set: common name=4,4-dimethyl-5α-cholesta-8-en-3-β-ol}} | ||
| + | {{#set: inchi key=InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N}} | ||
| + | {{#set: molecular weight=414.713 }} | ||
| + | {{#set: produced by=RXN66-14}} | ||
Latest revision as of 19:55, 21 March 2018
Contents
Metabolite CPD-8610
- smiles:
- CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C
- common name:
- 4,4-dimethyl-5α-cholesta-8-en-3-β-ol
- inchi key:
- InChIKey=FYHRVINOXYETMN-QGBOJXOESA-N
- molecular weight:
- 414.713
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)CCCC([CH]4(C1(C)([CH](C2(=C(CC1)C3(C)([CH](CC2)C(C)(C)C(O)CC3)))CC4)))C" cannot be used as a page name in this wiki.
