Difference between revisions of "AMETt2h"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATE DIHYDROFOLATE] == * smiles: ** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C3...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMETt2h AMETt2h] == * direction: ** REVERSIBLE * common name: ** S-Adenosyl-L-methionine reversible...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DIHYDROFOLATE DIHYDROFOLATE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=AMETt2h AMETt2h] ==
* smiles:
+
* direction:
** C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))
+
** REVERSIBLE
* inchi key:
+
** InChIKey=OZRNSSUDZOLUSN-LBPRGKRZSA-L
+
 
* common name:
 
* common name:
** 7,8-dihydrofolate monoglutamate
+
** S-Adenosyl-L-methionine reversible transport, chloroplast
* molecular weight:
+
** 441.402   
+
 
* Synonym(s):
 
* Synonym(s):
** 7,8-pteroylglutamic acid
 
** 7,8-pteroylglutamate
 
** 7,8-dihydropteroyl monoglutamate
 
** H2PteGlu
 
** H2PteGlu1
 
** dihydrofolate
 
** 7,8-dihydropteroylglutamate
 
** 7,8-dihydrofolate
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[R00939]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[ADENOSYL-HOMO-CYS]][c] '''+''' 1.0 [[S-ADENOSYLMETHIONINE]][h] '''<=>''' 1.0 [[S-ADENOSYLMETHIONINE]][c] '''+''' 1.0 [[ADENOSYL-HOMO-CYS]][h]
* [[DIHYDROFOLATESYNTH-RXN]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1.0 S-adenosyl-L-homocysteine[c] '''+''' 1.0 S-adenosyl-L-methionine[h] '''<=>''' 1.0 S-adenosyl-L-methionine[c] '''+''' 1.0 S-adenosyl-L-homocysteine[h]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3756]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_8828]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 4033-27-6
+
{{#set: direction=REVERSIBLE}}
* METABOLIGHTS : MTBLC57451
+
{{#set: common name=S-Adenosyl-L-methionine reversible transport, chloroplast}}
* PUBCHEM:
+
{{#set: gene associated=Tiso_gene_3756|Tiso_gene_8828}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40480038 40480038]
+
{{#set: in pathway=}}
* HMDB : HMDB01056
+
{{#set: reconstruction category=orthology}}
* LIGAND-CPD:
+
{{#set: reconstruction source=orthology-creinhardtii}}
** [http://www.genome.jp/dbget-bin/www_bget?C00415 C00415]
+
{{#set: reconstruction tool=pantograph}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57451 57451]
+
* BIGG : dhf
+
{{#set: smiles=C(NC1(C=CC(C(=O)NC(C(=O)[O-])CCC([O-])=O)=CC=1))C3(CNC2(=C(C(=O)NC(N)=N2)N=3))}}
+
{{#set: inchi key=InChIKey=OZRNSSUDZOLUSN-LBPRGKRZSA-L}}
+
{{#set: common name=7,8-dihydrofolate monoglutamate}}
+
{{#set: molecular weight=441.402    }}
+
{{#set: common name=7,8-pteroylglutamic acid|7,8-pteroylglutamate|7,8-dihydropteroyl monoglutamate|H2PteGlu|H2PteGlu1|dihydrofolate|7,8-dihydropteroylglutamate|7,8-dihydrofolate}}
+
{{#set: consumed by=R00939}}
+
{{#set: produced by=DIHYDROFOLATESYNTH-RXN}}
+

Latest revision as of 19:55, 21 March 2018

Reaction AMETt2h

  • direction:
    • REVERSIBLE
  • common name:
    • S-Adenosyl-L-methionine reversible transport, chloroplast
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links