Difference between revisions of "5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-5-PHOSPHORIBOSYL-ANTHRANILATE N-5-PHOSPHORIBOSYL-ANTHRANILATE] == * smiles: ** C(OP(=O)([O-])...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE] == * smiles: *...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE] == |
* smiles: | * smiles: | ||
− | ** C( | + | ** C(NC=O)C(=[N+])NC1(C(O)C(O)C(COP([O-])(=O)[O-])O1) |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine |
+ | * inchi key: | ||
+ | ** InChIKey=PMCOGCVKOAOZQM-XVFCMESISA-M | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 312.196 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 5-phosphoribosyl-N-formylglycineamidine |
− | + | ** 5'-phosphoribosyl-N-formyl glycineamidine | |
− | ** 5-phosphoribosyl- | + | ** FGAM |
− | + | ** 5'-phosphoribosylformylglycinamidine | |
− | ** | + | |
− | ** 5'- | + | |
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[AIRS-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[FGAMSYN-RXN]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
− | |||
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04640 C04640] |
− | {{#set: smiles=C( | + | * HMDB : HMDB06211 |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18413 18413] |
− | {{#set: molecular weight= | + | * BIGG : fpram |
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: consumed by= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657386 90657386] |
− | {{#set: | + | {{#set: smiles=C(NC=O)C(=[N+])NC1(C(O)C(O)C(COP([O-])(=O)[O-])O1)}} |
+ | {{#set: common name=2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine}} | ||
+ | {{#set: inchi key=InChIKey=PMCOGCVKOAOZQM-XVFCMESISA-M}} | ||
+ | {{#set: molecular weight=312.196 }} | ||
+ | {{#set: common name=5-phosphoribosyl-N-formylglycineamidine|5'-phosphoribosyl-N-formyl glycineamidine|FGAM|5'-phosphoribosylformylglycinamidine}} | ||
+ | {{#set: consumed by=AIRS-RXN}} | ||
+ | {{#set: produced by=FGAMSYN-RXN}} |
Latest revision as of 20:55, 21 March 2018
Contents
Metabolite 5-PHOSPHORIBOSYL-N-FORMYLGLYCINEAMIDINE
- smiles:
- C(NC=O)C(=[N+])NC1(C(O)C(O)C(COP([O-])(=O)[O-])O1)
- common name:
- 2-(formamido)-N1-(5-phospho-β-D-ribosyl)acetamidine
- inchi key:
- InChIKey=PMCOGCVKOAOZQM-XVFCMESISA-M
- molecular weight:
- 312.196
- Synonym(s):
- 5-phosphoribosyl-N-formylglycineamidine
- 5'-phosphoribosyl-N-formyl glycineamidine
- FGAM
- 5'-phosphoribosylformylglycinamidine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(NC=O)C(=[N+])NC1(C(O)C(O)C(COP([O-])(=O)[O-])O1)" cannot be used as a page name in this wiki.