Difference between revisions of "RXN-16066"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16066 RXN-16066] == * direction: ** REVERSIBLE * common name: ** 1-acylglycerol-3-phosphate_o-a...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16066 RXN-16066] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** 1-acylglycerol-3-phosphate_o-acyltransferase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | = | + | ** 1 [[ACYL-SN-GLYCEROL-3P]][c] '''+''' 1 [[Long-Chain-Acyl-CoAs]][c] '''<=>''' 1 [[L-PHOSPHATIDATE]][c] '''+''' 1 [[CO-A]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 a 1-acyl-sn-glycerol 3-phosphate[c] '''+''' 1 a long-chain acyl-CoA[c] '''<=>''' 1 a 1,2-diacyl-sn-glycerol 3-phosphate[c] '''+''' 1 coenzyme A[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_13959]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}} | |
− | + | {{#set: ec number=EC-2.3.1.51}} | |
− | + | {{#set: gene associated=Tiso_gene_13959}} | |
− | + | {{#set: in pathway=}} | |
− | + | {{#set: reconstruction category=annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}} | |
− | + | {{#set: reconstruction tool=pathwaytools}} | |
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:55, 21 March 2018
Contents
Reaction RXN-16066
- direction:
- REVERSIBLE
- common name:
- 1-acylglycerol-3-phosphate_o-acyltransferase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ACYL-SN-GLYCEROL-3P[c] + 1 Long-Chain-Acyl-CoAs[c] <=> 1 L-PHOSPHATIDATE[c] + 1 CO-A[c]
- With common name(s):
- 1 a 1-acyl-sn-glycerol 3-phosphate[c] + 1 a long-chain acyl-CoA[c] <=> 1 a 1,2-diacyl-sn-glycerol 3-phosphate[c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_13959
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation