Difference between revisions of "RXN-16066"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16066 RXN-16066] == * direction: ** REVERSIBLE * common name: ** 1-acylglycerol-3-phosphate_o-a...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-16066 RXN-16066] ==
* smiles:
+
* direction:
** CC1(=NC=C(CO)C(C[N+])=C(O)1)
+
** REVERSIBLE
* inchi key:
+
** InChIKey=NHZMQXZHNVQTQA-UHFFFAOYSA-O
+
 
* common name:
 
* common name:
** pyridoxamine
+
** 1-acylglycerol-3-phosphate_o-acyltransferase
* molecular weight:
+
* ec number:
** 169.203   
+
** [http://enzyme.expasy.org/EC/2.3.1.51 EC-2.3.1.51]
 
* Synonym(s):
 
* Synonym(s):
** PM
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[PYRAMKIN-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[ACYL-SN-GLYCEROL-3P]][c] '''+''' 1 [[Long-Chain-Acyl-CoAs]][c] '''<=>''' 1 [[L-PHOSPHATIDATE]][c] '''+''' 1 [[CO-A]][c]
* [[PYAMPP]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 a 1-acyl-sn-glycerol 3-phosphate[c] '''+''' 1 a long-chain acyl-CoA[c] '''<=>''' 1 a 1,2-diacyl-sn-glycerol 3-phosphate[c] '''+''' 1 coenzyme A[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_13959]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
* CAS : 85-87-0
+
{{#set: direction=REVERSIBLE}}
* METABOLIGHTS : MTBLC57761
+
{{#set: common name=1-acylglycerol-3-phosphate_o-acyltransferase}}
* PUBCHEM:
+
{{#set: ec number=EC-2.3.1.51}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245492 25245492]
+
{{#set: gene associated=Tiso_gene_13959}}
* HMDB : HMDB01431
+
{{#set: in pathway=}}
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
** [http://www.genome.jp/dbget-bin/www_bget?C00534 C00534]
+
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57761 57761]
+
* BIGG : pydam
+
{{#set: smiles=CC1(=NC=C(CO)C(C[N+])=C(O)1)}}
+
{{#set: inchi key=InChIKey=NHZMQXZHNVQTQA-UHFFFAOYSA-O}}
+
{{#set: common name=pyridoxamine}}
+
{{#set: molecular weight=169.203    }}
+
{{#set: common name=PM}}
+
{{#set: consumed by=PYRAMKIN-RXN}}
+
{{#set: produced by=PYAMPP}}
+

Latest revision as of 20:55, 21 March 2018

Reaction RXN-16066

  • direction:
    • REVERSIBLE
  • common name:
    • 1-acylglycerol-3-phosphate_o-acyltransferase
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links