Difference between revisions of "CPD-12230"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_18274 == * right end position: ** 3027 * transcription direction: ** POSITIVE * left end position: ** 2062 * centisome position: ** 66.0474...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12230 CPD-12230] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CC...")
 
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_18274 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12230 CPD-12230] ==
* right end position:
+
* smiles:
** 3027
+
** CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C3(OC9(OC(CO)C(OC8(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(CNC(=O)C(C)NC(=O)C(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC7(C(OC6(OC(CO)C(OC5(OC(CO)C(OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(CNC(=O)C(C)NC(=O)C(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC3C(NC(C)=O)4)C(=O)N)=O)=O)=O)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)5))C(O)C(NC(=O)C)6))C(CO)OC(O)C(NC(C)=O)7))C(=O)N)=O)=O)=O)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)8))C(O)C(NC(=O)C)9))))C)C)C)C)C)C
* transcription direction:
+
* common name:
** POSITIVE
+
** a peptidoglycan with D,D cross-link (S. aureus)
* left end position:
+
* inchi key:
** 2062
+
** InChIKey=CPYBFCKZOJOYOB-QRBVYMFTSA-L
* centisome position:
+
* molecular weight:
** 66.04741    
+
** 5555.933    
 
* Synonym(s):
 
* Synonym(s):
 +
** N-acetylglucosamine--N-acetylmuramoyl-(tetrapeptide) diphospho-undecaprenol dimer with D,D cross-link (S. aureus)
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* Reaction: [[HISTONE-ACETYLTRANSFERASE-RXN]]
+
== Reaction(s) known to produce the compound ==
** Source: [[annotation-in-silico_annotation]]
+
* [[RXN-11065]]
*** Assignment: ec-number
+
== Reaction(s) of unknown directionality ==
== Pathways associated ==
+
 
== External links  ==
 
== External links  ==
{{#set: right end position=3027}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659363 90659363]
{{#set: left end position=2062}}
+
{{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C3(OC9(OC(CO)C(OC8(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(CNC(=O)C(C)NC(=O)C(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC7(C(OC6(OC(CO)C(OC5(OC(CO)C(OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(CNC(=O)C(C)NC(=O)C(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC3C(NC(C)=O)4)C(=O)N)=O)=O)=O)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)5))C(O)C(NC(=O)C)6))C(CO)OC(O)C(NC(C)=O)7))C(=O)N)=O)=O)=O)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)8))C(O)C(NC(=O)C)9))))C)C)C)C)C)C}}
{{#set: centisome position=66.04741   }}
+
{{#set: common name=a peptidoglycan with D,D cross-link (S. aureus)}}
{{#set: reaction associated=HISTONE-ACETYLTRANSFERASE-RXN}}
+
{{#set: inchi key=InChIKey=CPYBFCKZOJOYOB-QRBVYMFTSA-L}}
 +
{{#set: molecular weight=5555.933   }}
 +
{{#set: common name=N-acetylglucosamine--N-acetylmuramoyl-(tetrapeptide) diphospho-undecaprenol dimer with D,D cross-link (S. aureus)}}
 +
{{#set: produced by=RXN-11065}}

Latest revision as of 20:55, 21 March 2018

Metabolite CPD-12230

  • smiles:
    • CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C3(OC9(OC(CO)C(OC8(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(CNC(=O)C(C)NC(=O)C(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC7(C(OC6(OC(CO)C(OC5(OC(CO)C(OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(CNC(=O)C(C)NC(=O)C(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC3C(NC(C)=O)4)C(=O)N)=O)=O)=O)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)5))C(O)C(NC(=O)C)6))C(CO)OC(O)C(NC(C)=O)7))C(=O)N)=O)=O)=O)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)8))C(O)C(NC(=O)C)9))))C)C)C)C)C)C
  • common name:
    • a peptidoglycan with D,D cross-link (S. aureus)
  • inchi key:
    • InChIKey=CPYBFCKZOJOYOB-QRBVYMFTSA-L
  • molecular weight:
    • 5555.933
  • Synonym(s):
    • N-acetylglucosamine--N-acetylmuramoyl-(tetrapeptide) diphospho-undecaprenol dimer with D,D cross-link (S. aureus)

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)=CCCC(C)=CCCC(C)=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(C)=CCCC(=CCCC(=CCCC(=CCOP(=O)([O-])OP(=O)([O-])OC4(OC(CO)C3(OC9(OC(CO)C(OC8(OC(CO)C(OC1(OC(CO)C(O)C(O)C(NC(=O)C)1))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(CNC(=O)C(C)NC(=O)C(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC7(C(OC6(OC(CO)C(OC5(OC(CO)C(OC2(OC(CO)C(O)C(O)C(NC(=O)C)2))C(OC(C)C(=O)NC(C)C(=O)NC(CCC(=O)NC(CCCCNC(CNC(CNC(CNC(CNC(CNC(=O)C(C)NC(=O)C(CCCCNC(CNC(CNC(CNC(CNC(C[N+])=O)=O)=O)=O)=O)NC(=O)CCC(NC(=O)C(C)NC(=O)C(C)OC3C(NC(C)=O)4)C(=O)N)=O)=O)=O)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)5))C(O)C(NC(=O)C)6))C(CO)OC(O)C(NC(C)=O)7))C(=O)N)=O)=O)=O)=O)=O)C(NC(C)C([O-])=O)=O)C(=O)N)C(NC(C)=O)8))C(O)C(NC(=O)C)9))))C)C)C)C)C)C" cannot be used as a page name in this wiki.