Difference between revisions of "COBALAMINSYN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=COBALAMINSYN-RXN COBALAMINSYN-RXN] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.exp...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=COBALAMINSYN-RXN COBALAMINSYN-RXN] ==
* smiles:
+
* direction:
** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** REVERSIBLE
* inchi key:
+
* ec number:
** InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J
+
** [http://enzyme.expasy.org/EC/2.7.8.26 EC-2.7.8.26]
* common name:
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA
+
* molecular weight:
+
** 1037.905   
+
 
* Synonym(s):
 
* Synonym(s):
** OPC8-trans-2-enoyl-CoA
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[RXN-10697]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[ADENOSYLCOBINAMIDE-GDP]][c] '''+''' 1 [[ALPHA-RIBAZOLE]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[ADENOSYLCOBALAMIN]][c] '''+''' 1 [[GMP]][c]
* [[RXN-10696]]
+
* With common name(s):
== Reaction(s) of unknown directionality ==
+
** 1 adenosylcobinamide-GDP[c] '''+''' 1 &alpha;-ribazole[c] '''<=>''' 1 H+[c] '''+''' 1 adenosylcobalamin[c] '''+''' 1 GMP[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_8411]]
 +
** Source: [[orthology-synechocystis]]
 +
* Gene: [[Tiso_gene_8410]]
 +
** Source: [[orthology-synechocystis]]
 +
== Pathways  ==
 +
* [[PWY-5508]], adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5508 PWY-5508]
 +
** '''3''' reactions found over '''9''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-synechocystis]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
* RHEA:
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237209 44237209]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=16049 16049]
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
* LIGAND-RXN:
{{#set: inchi key=InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R05223 R05223]
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA}}
+
{{#set: direction=REVERSIBLE}}
{{#set: molecular weight=1037.905    }}
+
{{#set: ec number=EC-2.7.8.26}}
{{#set: common name=OPC8-trans-2-enoyl-CoA}}
+
{{#set: gene associated=Tiso_gene_8411|Tiso_gene_8410}}
{{#set: consumed by=RXN-10697}}
+
{{#set: in pathway=PWY-5508}}
{{#set: produced by=RXN-10696}}
+
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-synechocystis}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 19:55, 21 March 2018

Reaction COBALAMINSYN-RXN

  • direction:
    • REVERSIBLE
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5508, adenosylcobalamin biosynthesis from cobyrinate a,c-diamide II: PWY-5508
    • 3 reactions found over 9 reactions in the full pathway

Reconstruction information

External links