Difference between revisions of "CPD-11518"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Tiso_gene_15687 == * left end position: ** 1916 * transcription direction: ** POSITIVE * right end position: ** 4355 * centisome position: ** 39.3025...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)CO...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
[[Category:Gene]]
+
[[Category:Metabolite]]
== Gene Tiso_gene_15687 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11518 CPD-11518] ==
* left end position:
+
* smiles:
** 1916
+
** CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
* transcription direction:
+
* common name:
** POSITIVE
+
** 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA
* right end position:
+
* inchi key:
** 4355
+
** InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J
* centisome position:
+
* molecular weight:
** 39.302563    
+
** 1037.905    
 
* Synonym(s):
 
* Synonym(s):
 +
** OPC8-trans-2-enoyl-CoA
  
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
* [[PGLYCDEHYDROG-RXN]]
+
* [[RXN-10697]]
** in-silico_annotation
+
== Reaction(s) known to produce the compound ==
***ec-number
+
* [[RXN-10696]]
** experimental_annotation
+
== Reaction(s) of unknown directionality ==
***ec-number
+
** [[pantograph]]-[[athaliana]]
+
** [[pantograph]]-[[synechocystis]]
+
** [[pantograph]]-[[esiliculosus]]
+
** [[pantograph]]-[[creinhardtii]]
+
* [[RXN0-300]]
+
** [[pantograph]]-[[synechocystis]]
+
== Pathways associated ==
+
* [[SERSYN-PWY]]
+
 
== External links  ==
 
== External links  ==
{{#set: left end position=1916}}
+
* PUBCHEM:
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237209 44237209]
{{#set: right end position=4355}}
+
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
{{#set: centisome position=39.302563   }}
+
{{#set: common name=3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA}}
{{#set: reaction associated=PGLYCDEHYDROG-RXN|RXN0-300}}
+
{{#set: inchi key=InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J}}
{{#set: pathway associated=SERSYN-PWY}}
+
{{#set: molecular weight=1037.905   }}
 +
{{#set: common name=OPC8-trans-2-enoyl-CoA}}
 +
{{#set: consumed by=RXN-10697}}
 +
{{#set: produced by=RXN-10696}}

Latest revision as of 20:55, 21 March 2018

Metabolite CPD-11518

  • smiles:
    • CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
  • common name:
    • 3-oxo-2-(cis-2'-pentenyl)-cyclopentane-1-octa-2-enoyl-CoA
  • inchi key:
    • InChIKey=WDBPMRZYBZCIQE-WCBSGRPJSA-J
  • molecular weight:
    • 1037.905
  • Synonym(s):
    • OPC8-trans-2-enoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCC=CCC4(C(=O)CCC(CCCCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)" cannot be used as a page name in this wiki.