Difference between revisions of "DCMP"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXAMINE PYRIDOXAMINE] == * smiles: ** CC1(=NC=C(CO)C(C[N+])=C(O)1) * inchi key: ** InChIKe...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] == * smiles: ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O * common name:...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DCMP DCMP] == |
* smiles: | * smiles: | ||
− | ** | + | ** C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** dCMP |
+ | * inchi key: | ||
+ | ** InChIKey=NCMVOABPESMRCP-SHYZEUOFSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 305.183 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2'-deoxycytidine 5'-monophosphate |
+ | ** deoxycytidylate | ||
+ | ** deoxycytidylic acid | ||
+ | ** deoxycytidine monophosphate | ||
+ | ** 2'-deoxycytidine 5'-phosphate | ||
+ | ** deoxycytidine-phosphate | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[ATDCM]] |
+ | * [[RXN-7913]] | ||
+ | * [[DCMP-DEAMINASE-RXN]] | ||
+ | * [[ATDCMf]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[DCTP-PYROPHOSPHATASE-RXN]] |
+ | * [[DCYTPT]] | ||
+ | * [[RXN-14198]] | ||
+ | * [[RXN-14187]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | * CAS : | + | * CAS : 1032-65-1 |
− | * | + | * BIGG : dcmp |
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7058169 7058169] |
− | * HMDB : | + | * HMDB : HMDB01202 |
* LIGAND-CPD: | * LIGAND-CPD: | ||
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00239 C00239] |
+ | * CHEMSPIDER: | ||
+ | ** [http://www.chemspider.com/Chemical-Structure.5414501.html 5414501] | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57566 57566] |
− | * | + | * METABOLIGHTS : MTBLC57566 |
− | {{#set: smiles= | + | {{#set: smiles=C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O}} |
− | {{#set: | + | {{#set: common name=dCMP}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=NCMVOABPESMRCP-SHYZEUOFSA-L}} |
− | {{#set: molecular weight= | + | {{#set: molecular weight=305.183 }} |
− | {{#set: common name= | + | {{#set: common name=2'-deoxycytidine 5'-monophosphate|deoxycytidylate|deoxycytidylic acid|deoxycytidine monophosphate|2'-deoxycytidine 5'-phosphate|deoxycytidine-phosphate}} |
− | {{#set: consumed by= | + | {{#set: consumed by=ATDCM|RXN-7913|DCMP-DEAMINASE-RXN|ATDCMf}} |
− | {{#set: produced by= | + | {{#set: produced by=DCTP-PYROPHOSPHATASE-RXN|DCYTPT|RXN-14198|RXN-14187}} |
Latest revision as of 19:55, 21 March 2018
Contents
Metabolite DCMP
- smiles:
- C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O
- common name:
- dCMP
- inchi key:
- InChIKey=NCMVOABPESMRCP-SHYZEUOFSA-L
- molecular weight:
- 305.183
- Synonym(s):
- 2'-deoxycytidine 5'-monophosphate
- deoxycytidylate
- deoxycytidylic acid
- deoxycytidine monophosphate
- 2'-deoxycytidine 5'-phosphate
- deoxycytidine-phosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 1032-65-1
- BIGG : dcmp
- PUBCHEM:
- HMDB : HMDB01202
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC57566
"C(C2(C(CC(N1(C(N=C(C=C1)N)=O))O2)O))OP([O-])([O-])=O" cannot be used as a page name in this wiki.