Difference between revisions of "Tiso gene 18937"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CIS-ACONITATE CIS-ACONITATE] == * smiles: ** C([O-])(=O)C(=CC(=O)[O-])CC(=O)[O-] * inchi key: *...") |
(Created page with "Category:Gene == Gene Tiso_gene_18937 == * right end position: ** 2697 * transcription direction: ** POSITIVE * left end position: ** 2127 * centisome position: ** 78.7486...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18937 == |
− | * | + | * right end position: |
− | ** | + | ** 2697 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 2127 |
− | * | + | * centisome position: |
− | ** | + | ** 78.74861 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[DAHPSYN-RXN]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | == Pathways associated == |
+ | * [[PWY-6164]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2697}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=2127}} | |
− | + | {{#set: centisome position=78.74861 }} | |
− | + | {{#set: reaction associated=DAHPSYN-RXN}} | |
− | + | {{#set: pathway associated=PWY-6164}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:55, 21 March 2018
Gene Tiso_gene_18937
- right end position:
- 2697
- transcription direction:
- POSITIVE
- left end position:
- 2127
- centisome position:
- 78.74861
- Synonym(s):
Reactions associated
- Reaction: DAHPSYN-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation