Difference between revisions of "RXN-9526"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-MALTOSE ALPHA-MALTOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O * in...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9526 RXN-9526] == * direction: ** LEFT-TO-RIGHT * common name: ** trans oct-2-enoyl-[acyl-carri...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-MALTOSE ALPHA-MALTOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9526 RXN-9526] ==
−
* smiles:
+
* direction:
−
** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=GUBGYTABKSRVRQ-ASMJPISFSA-N
+
 
* common name:
 
* common name:
−
** α-maltose
+
** trans oct-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)
−
* molecular weight:
+
** polyketide_synthase
−
** 342.299   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.3.1.10 EC-1.3.1.10]
 +
** [http://enzyme.expasy.org/EC/1.3.1.39 EC-1.3.1.39]
 +
** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85]
 +
** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86]
 
* Synonym(s):
 
* Synonym(s):
 +
** trans oct-2-enoyl-ACP reductase
 +
** trans oct-2-enoyl acyl-carrier-protein reductase
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-2141]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[2-Octenoyl-ACPs]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Octanoyl-ACPs]][c] '''+''' 1 [[NADP]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a trans oct-2-enoyl-[acp][c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 an octanoyl-[acp][c] '''+''' 1 NADP+[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10876]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_135]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_500]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_13394]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994]
 +
** '''31''' reactions found over '''31''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[manual]]
 +
** Source: [[manual-primary_network]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439341 439341]
+
{{#set: common name=trans oct-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)}}
−
* HMDB : HMDB00163
+
{{#set: common name=polyketide_synthase}}
−
* LIGAND-CPD:
+
{{#set: ec number=EC-1.3.1.10}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00897 C00897]
+
{{#set: ec number=EC-1.3.1.39}}
−
* CHEMSPIDER:
+
{{#set: ec number=EC-2.3.1.85}}
−
** [http://www.chemspider.com/Chemical-Structure.388469.html 388469]
+
{{#set: ec number=EC-2.3.1.86}}
−
* CHEBI:
+
{{#set: common name=trans oct-2-enoyl-ACP reductase|trans oct-2-enoyl acyl-carrier-protein reductase}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18167 18167]
+
{{#set: gene associated=Tiso_gene_10876|Tiso_gene_136|Tiso_gene_135|Tiso_gene_500|Tiso_gene_13394}}
−
* METABOLIGHTS : MTBLC18167
+
{{#set: in pathway=PWY-5994}}
−
{{#set: smiles=C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O}}
+
{{#set: reconstruction category=manual|annotation}}
−
{{#set: inchi key=InChIKey=GUBGYTABKSRVRQ-ASMJPISFSA-N}}
+
{{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation}}
−
{{#set: common name=α-maltose}}
+
{{#set: reconstruction tool=pathwaytools}}
−
{{#set: molecular weight=342.299    }}
+
−
{{#set: consumed by=RXN-2141}}
+

Latest revision as of 19:56, 21 March 2018

Reaction RXN-9526

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • trans oct-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)
    • polyketide_synthase
  • ec number:
  • Synonym(s):
    • trans oct-2-enoyl-ACP reductase
    • trans oct-2-enoyl acyl-carrier-protein reductase

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
    • 31 reactions found over 31 reactions in the full pathway

Reconstruction information

External links

"trans oct-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)" cannot be used as a page name in this wiki.






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-9526&oldid=44701"