Difference between revisions of "RXN-9526"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALPHA-MALTOSE ALPHA-MALTOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(OC(C(C2O)O)O)CO)))O * in...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9526 RXN-9526] == * direction: ** LEFT-TO-RIGHT * common name: ** trans oct-2-enoyl-[acyl-carri...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-9526 RXN-9526] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** trans oct-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific) |
− | * | + | ** polyketide_synthase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.3.1.10 EC-1.3.1.10] | ||
+ | ** [http://enzyme.expasy.org/EC/1.3.1.39 EC-1.3.1.39] | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.1.85 EC-2.3.1.85] | ||
+ | ** [http://enzyme.expasy.org/EC/2.3.1.86 EC-2.3.1.86] | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** trans oct-2-enoyl-ACP reductase | ||
+ | ** trans oct-2-enoyl acyl-carrier-protein reductase | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[2-Octenoyl-ACPs]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[PROTON]][c] '''=>''' 1 [[Octanoyl-ACPs]][c] '''+''' 1 [[NADP]][c] |
− | == | + | * With common name(s): |
+ | ** 1 a trans oct-2-enoyl-[acp][c] '''+''' 1 NADPH[c] '''+''' 1 H+[c] '''=>''' 1 an octanoyl-[acp][c] '''+''' 1 NADP+[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_10876]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_136]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_135]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_500]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | * Gene: [[Tiso_gene_13394]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-5994]], palmitate biosynthesis I (animals and fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5994 PWY-5994] | ||
+ | ** '''31''' reactions found over '''31''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[manual]] | ||
+ | ** Source: [[manual-primary_network]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=trans oct-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)}} | |
− | + | {{#set: common name=polyketide_synthase}} | |
− | + | {{#set: ec number=EC-1.3.1.10}} | |
− | + | {{#set: ec number=EC-1.3.1.39}} | |
− | + | {{#set: ec number=EC-2.3.1.85}} | |
− | + | {{#set: ec number=EC-2.3.1.86}} | |
− | + | {{#set: common name=trans oct-2-enoyl-ACP reductase|trans oct-2-enoyl acyl-carrier-protein reductase}} | |
− | + | {{#set: gene associated=Tiso_gene_10876|Tiso_gene_136|Tiso_gene_135|Tiso_gene_500|Tiso_gene_13394}} | |
− | + | {{#set: in pathway=PWY-5994}} | |
− | {{#set: | + | {{#set: reconstruction category=manual|annotation}} |
− | {{#set: | + | {{#set: reconstruction source=manual-primary_network|annotation-in-silico_annotation}} |
− | {{#set: | + | {{#set: reconstruction tool=pathwaytools}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:56, 21 March 2018
Contents
Reaction RXN-9526
- direction:
- LEFT-TO-RIGHT
- common name:
- trans oct-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)
- polyketide_synthase
- ec number:
- Synonym(s):
- trans oct-2-enoyl-ACP reductase
- trans oct-2-enoyl acyl-carrier-protein reductase
Reaction Formula
- With identifiers:
- 1 2-Octenoyl-ACPs[c] + 1 NADPH[c] + 1 PROTON[c] => 1 Octanoyl-ACPs[c] + 1 NADP[c]
- With common name(s):
- 1 a trans oct-2-enoyl-[acp][c] + 1 NADPH[c] + 1 H+[c] => 1 an octanoyl-[acp][c] + 1 NADP+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_10876
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_136
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_135
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_500
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_13394
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-5994, palmitate biosynthesis I (animals and fungi): PWY-5994
- 31 reactions found over 31 reactions in the full pathway
Reconstruction information
- Category: manual
- Source: manual-primary_network
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
"trans oct-2-enoyl-[acyl-carrier protein] reductase (NADPH, B-specific)" cannot be used as a page name in this wiki.