Difference between revisions of "Holo-VibB"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8564 CPD-8564] == * smiles: ** C(O)C(C(=O)N[R])NC(=O)[R] * common name: ** myosin light-cha...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=holo-VibB holo-VibB] == * common name: ** a holo-[VibB aryl-carrier protein] * Synonym(s): ==...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=holo-VibB holo-VibB] == |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a holo-[VibB aryl-carrier protein] |
* Synonym(s): | * Synonym(s): | ||
| Line 10: | Line 8: | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-10994]] |
== External links == | == External links == | ||
| − | + | {{#set: common name=a holo-[VibB aryl-carrier protein]}} | |
| − | + | {{#set: reversible reaction associated=RXN-10994}} | |
| − | + | ||
| − | {{#set: common name= | + | |
| − | {{#set: reversible reaction associated= | + | |
Latest revision as of 19:56, 21 March 2018
Contents
Metabolite holo-VibB
- common name:
- a holo-[VibB aryl-carrier protein]
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"a holo-[VibB aryl-carrier protein" cannot be used as a page name in this wiki.
