Difference between revisions of "CPD-15318"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPPSYN-RXN FPPSYN-RXN] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/E...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * common name: ** &a...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=FPPSYN-RXN FPPSYN-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
−
* ec number:
+
* common name:
−
** [http://enzyme.expasy.org/EC/2.5.1.10 EC-2.5.1.10]
+
** α-D-ribose 5-phosphate
 +
* inchi key:
 +
** InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L
 +
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** α-D-ribofuranose 5-phosphate
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[R5PDP]]
−
** 1 [[GERANYL-PP]][c] '''+''' 1 [[DELTA3-ISOPENTENYL-PP]][c] '''=>''' 1 [[FARNESYL-PP]][c] '''+''' 1 [[PPI]][c]
+
* [[RXN-14997]]
−
* With common name(s):
+
* [[RXN-15345]]
−
** 1 geranyl diphosphate[c] '''+''' 1 isopentenyl diphosphate[c] '''=>''' 1 (2E,6E)-farnesyl diphosphate[c] '''+''' 1 diphosphate[c]
+
== Reaction(s) known to produce the compound ==
−
 
+
* [[ARDP]]
−
== Genes associated with this reaction  ==
+
* [[RIBOKIN-RXN]]
−
Genes have been associated with this reaction based on different elements listed below.
+
== Reaction(s) of unknown directionality ==
−
* [[Tiso_gene_16284]]
+
* [[RPDPK]]
−
** [[pantograph]]-[[athaliana]]
+
* [[RXN-14456]]
−
** [[pantograph]]-[[synechocystis]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY-7736]], stellatic acid biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7736 PWY-7736]
+
−
** '''3''' reactions found over '''8''' reactions in the full pathway
+
−
* [[PWY-6859]], all-trans-farnesol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6859 PWY-6859]
+
−
** '''3''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-5123]], trans, trans-farnesyl diphosphate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5123 PWY-5123]
+
−
** '''3''' reactions found over '''3''' reactions in the full pathway
+
−
* [[PWY-7721]], methyl phomopsenoate biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7721 PWY-7721]
+
−
** '''2''' reactions found over '''4''' reactions in the full pathway
+
−
* [[PWY-7102]], bisabolene biosynthesis (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7102 PWY-7102]
+
−
** '''3''' reactions found over '''6''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[synechocystis]]
+
−
*** [[athaliana]]
+
−
*** [[esiliculosus]]
+
−
* [[manual]]:
+
−
** [[primary_network]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=19361 19361]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7098640 7098640]
−
* LIGAND-RXN:
+
* CHEBI:
−
** [http://www.genome.jp/dbget-bin/www_bget?R02003 R02003]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=18189 18189]
−
* UNIPROT:
+
* METABOLIGHTS : MTBLC18189
−
** [http://www.uniprot.org/uniprot/P08524 P08524]
+
{{#set: smiles=C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)}}
−
** [http://www.uniprot.org/uniprot/P05369 P05369]
+
{{#set: common name=α-D-ribose 5-phosphate}}
−
** [http://www.uniprot.org/uniprot/P14324 P14324]
+
{{#set: inchi key=InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L}}
−
** [http://www.uniprot.org/uniprot/Q9CH81 Q9CH81]
+
{{#set: molecular weight=228.095    }}
−
** [http://www.uniprot.org/uniprot/Q9PM32 Q9PM32]
+
{{#set: common name=α-D-ribofuranose 5-phosphate}}
−
** [http://www.uniprot.org/uniprot/P45204 P45204]
+
{{#set: consumed by=R5PDP|RXN-14997|RXN-15345}}
−
** [http://www.uniprot.org/uniprot/Q9JSM0 Q9JSM0]
+
{{#set: produced by=ARDP|RIBOKIN-RXN}}
−
** [http://www.uniprot.org/uniprot/P49350 P49350]
+
{{#set: reversible reaction associated=RPDPK|RXN-14456}}
−
** [http://www.uniprot.org/uniprot/P22939 P22939]
+
−
** [http://www.uniprot.org/uniprot/Q08291 Q08291]
+
−
** [http://www.uniprot.org/uniprot/P49349 P49349]
+
−
** [http://www.uniprot.org/uniprot/Q09152 Q09152]
+
−
** [http://www.uniprot.org/uniprot/P49351 P49351]
+
−
** [http://www.uniprot.org/uniprot/P49352 P49352]
+
−
** [http://www.uniprot.org/uniprot/Q43315 Q43315]
+
−
** [http://www.uniprot.org/uniprot/O24241 O24241]
+
−
** [http://www.uniprot.org/uniprot/O24242 O24242]
+
−
** [http://www.uniprot.org/uniprot/Q92334 Q92334]
+
−
** [http://www.uniprot.org/uniprot/Q92218 Q92218]
+
−
** [http://www.uniprot.org/uniprot/Q92235 Q92235]
+
−
** [http://www.uniprot.org/uniprot/Q92250 Q92250]
+
−
** [http://www.uniprot.org/uniprot/Q8L7F4 Q8L7F4]
+
−
** [http://www.uniprot.org/uniprot/P49353 P49353]
+
−
** [http://www.uniprot.org/uniprot/O04882 O04882]
+
−
** [http://www.uniprot.org/uniprot/O65004 O65004]
+
−
** [http://www.uniprot.org/uniprot/O14230 O14230]
+
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: ec number=EC-2.5.1.10}}
+
−
{{#set: gene associated=Tiso_gene_16284}}
+
−
{{#set: in pathway=PWY-7736|PWY-6859|PWY-5123|PWY-7721|PWY-7102}}
+
−
{{#set: reconstruction category=orthology}}
+
−
{{#set: reconstruction tool=pantograph}}
+
−
{{#set: reconstruction source=synechocystis|athaliana|esiliculosus}}
+
−
{{#set: reconstruction category=manual}}
+
−
{{#set: reconstruction source=primary_network}}
+

Latest revision as of 19:56, 21 March 2018

Metabolite CPD-15318

  • smiles:
    • C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)
  • common name:
    • α-D-ribose 5-phosphate
  • inchi key:
    • InChIKey=KTVPXOYAKDPRHY-AIHAYLRMSA-L
  • molecular weight:
    • 228.095
  • Synonym(s):
    • α-D-ribofuranose 5-phosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1)" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-15318&oldid=44773"