Difference between revisions of "RXN-13112"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13112 RXN-13112] == * direction: ** REVERSIBLE * ec number: ** [http://enzyme.expasy.org/EC/2.3...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13112 RXN-13112] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/2.3.1.198 EC-2.3.1.198] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | + | ** 1 [[ACYL-COA]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''<=>''' 1 [[2-Acyl-sn-glycerol-3-phosphates]][c] '''+''' 1 [[CO-A]][c] | |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 an acyl-CoA[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''<=>''' 1 a 2-acyl-sn-glycerol 3-phosphate[c] '''+''' 1 coenzyme A[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | == | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_7195]] |
− | * [[ | + | ** Source: [[orthology-athaliana]] |
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=33562 33562] | |
− | + | {{#set: direction=REVERSIBLE}} | |
− | ** [http://www.ebi.ac.uk/ | + | {{#set: ec number=EC-2.3.1.198}} |
− | + | {{#set: gene associated=Tiso_gene_7195}} | |
− | {{#set: | + | {{#set: in pathway=}} |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-athaliana}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 20:56, 21 March 2018
Contents
Reaction RXN-13112
- direction:
- REVERSIBLE
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 ACYL-COA[c] + 1 GLYCEROL-3P[c] <=> 1 2-Acyl-sn-glycerol-3-phosphates[c] + 1 CO-A[c]
- With common name(s):
- 1 an acyl-CoA[c] + 1 sn-glycerol 3-phosphate[c] <=> 1 a 2-acyl-sn-glycerol 3-phosphate[c] + 1 coenzyme A[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_7195
- Source: orthology-athaliana
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-athaliana
External links
- RHEA: