Difference between revisions of "Tiso gene 5334"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] == * smiles: ** CC(=O)NC(C([O-])=O)CCC(=O)OP([O-])(=O)...")
(Created page with "Category:Gene == Gene Tiso_gene_5334 == * right end position: ** 10356 * transcription direction: ** POSITIVE * left end position: ** 10225 * centisome position: ** 51.534...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-ACETYL-GLUTAMYL-P N-ACETYL-GLUTAMYL-P] ==
+
== Gene Tiso_gene_5334 ==
−
* smiles:
+
* right end position:
−
** CC(=O)NC(C([O-])=O)CCC(=O)OP([O-])(=O)[O-]
+
** 10356
−
* inchi key:
+
* transcription direction:
−
** InChIKey=FCVIHFVSXHOPSW-YFKPBYRVSA-K
+
** POSITIVE
−
* common name:
+
* left end position:
−
** N-acetylglutamyl-phosphate
+
** 10225
−
* molecular weight:
+
* centisome position:
−
** 266.124    
+
** 51.5347    
 
* Synonym(s):
 
* Synonym(s):
−
** N-Acetyl-L-glutamyl 5-phosphate
 
−
** N-acetyl-L-glutamate-5-phosphate
 
−
** N-acetyl-glutamyl-P
 
−
** N-acetylglutamyl-P
 
−
** N-acetyl-5-glutamyl phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[GLYCPDIESTER-RXN]]
−
* [[AGK]]
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[N-ACETYLGLUTPREDUCT-RXN]]
+
* Reaction: [[RXN-14073]]
−
* [[ACETYLGLUTKIN-RXN]]
+
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14136]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14160]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7409]]
 +
* [[PWY-6952]]
 
== External links  ==
 
== External links  ==
−
* BIGG : acg5p
+
{{#set: right end position=10356}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791951 49791951]
+
{{#set: left end position=10225}}
−
* HMDB : HMDB06456
+
{{#set: centisome position=51.5347   }}
−
* LIGAND-CPD:
+
{{#set: reaction associated=GLYCPDIESTER-RXN|RXN-14073|RXN-14136|RXN-14160}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C04133 C04133]
+
{{#set: pathway associated=PWY-7409|PWY-6952}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57936 57936]
+
−
* METABOLIGHTS : MTBLC57936
+
−
{{#set: smiles=CC(=O)NC(C([O-])=O)CCC(=O)OP([O-])(=O)[O-]}}
+
−
{{#set: inchi key=InChIKey=FCVIHFVSXHOPSW-YFKPBYRVSA-K}}
+
−
{{#set: common name=N-acetylglutamyl-phosphate}}
+
−
{{#set: molecular weight=266.124   }}
+
−
{{#set: common name=N-Acetyl-L-glutamyl 5-phosphate|N-acetyl-L-glutamate-5-phosphate|N-acetyl-glutamyl-P|N-acetylglutamyl-P|N-acetyl-5-glutamyl phosphate}}
+
−
{{#set: produced by=AGK}}
+
−
{{#set: reversible reaction associated=N-ACETYLGLUTPREDUCT-RXN|ACETYLGLUTKIN-RXN}}
+

Latest revision as of 19:56, 21 March 2018

Gene Tiso_gene_5334

  • right end position:
    • 10356
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10225
  • centisome position:
    • 51.5347
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_5334&oldid=44799"