Difference between revisions of "LYSOPHOSPHOLIPASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CYTIDINE CYTIDINE] == * smiles: ** C(C2(C(C(C(N1(C(N=C(C=C1)N)=O))O2)O)O))O * inchi key: ** InC...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LYSOPHOSPHOLIPASE-RXN LYSOPHOSPHOLIPASE-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** lys...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=LYSOPHOSPHOLIPASE-RXN LYSOPHOSPHOLIPASE-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** lysophospholipase |
− | * | + | ** ORF |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/3.1.1.5 EC-3.1.1.5] | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | * [[ | + | ** 1 [[WATER]][c] '''+''' 1 [[2-Lysophosphatidylcholines]][c] '''=>''' 1 [[L-1-GLYCERO-PHOSPHORYLCHOLINE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[Carboxylates]][c] |
− | * [[ | + | * With common name(s): |
− | * [[ | + | ** 1 H2O[c] '''+''' 1 a 1-acyl-sn-glycero-3-phosphocholine[c] '''=>''' 1 sn-glycero-3-phosphocholine[c] '''+''' 1 H+[c] '''+''' 1 a carboxylate[c] |
− | * [[ | + | |
− | * [[ | + | == Genes associated with this reaction == |
− | * [[ | + | Genes have been associated with this reaction based on different elements listed below. |
− | * [[ | + | * Gene: [[Tiso_gene_334]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | * [[ | + | * Gene: [[Tiso_gene_12478]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * [[ | + | * Gene: [[Tiso_gene_20565]] |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
− | == | + | * Gene: [[Tiso_gene_12479]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: EC-NUMBER |
− | * [[ | + | * Gene: [[Tiso_gene_12375]] |
− | * [[ | + | ** Source: [[annotation-in-silico_annotation]] |
− | + | *** Assignment: EC-NUMBER | |
+ | * Gene: [[Tiso_gene_8353]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_19778]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: AUTOMATED-NAME-MATCH | ||
+ | * Gene: [[Tiso_gene_2505]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_15692]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=15177 15177] | |
− | + | * LIGAND-RXN: | |
− | + | ** [http://www.genome.jp/dbget-bin/www_bget?R02746 R02746] | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R07291 R07291] |
− | * | + | * UNIPROT: |
− | * | + | ** [http://www.uniprot.org/uniprot/O07427 O07427] |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://www.uniprot.org/uniprot/Q7M3V3 Q7M3V3] |
− | * | + | ** [http://www.uniprot.org/uniprot/P07000 P07000] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P0ADA1 P0ADA1] |
− | * | + | ** [http://www.uniprot.org/uniprot/P39457 P39457] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/Q03674 Q03674] |
− | * | + | ** [http://www.uniprot.org/uniprot/P53541 P53541] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P78854 P78854] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O42970 O42970] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/Q9P327 Q9P327] |
− | {{#set: | + | {{#set: direction=LEFT-TO-RIGHT}} |
− | {{#set: | + | {{#set: common name=lysophospholipase}} |
− | {{#set: | + | {{#set: common name=ORF}} |
+ | {{#set: ec number=EC-3.1.1.5}} | ||
+ | {{#set: gene associated=Tiso_gene_334|Tiso_gene_12478|Tiso_gene_20565|Tiso_gene_12479|Tiso_gene_12375|Tiso_gene_8353|Tiso_gene_19778|Tiso_gene_2505|Tiso_gene_15692}} | ||
+ | {{#set: in pathway=}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=annotation-experimental_annotation|annotation-in-silico_annotation|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 19:57, 21 March 2018
Contents
Reaction LYSOPHOSPHOLIPASE-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- lysophospholipase
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 WATER[c] + 1 2-Lysophosphatidylcholines[c] => 1 L-1-GLYCERO-PHOSPHORYLCHOLINE[c] + 1 PROTON[c] + 1 Carboxylates[c]
- With common name(s):
- 1 H2O[c] + 1 a 1-acyl-sn-glycero-3-phosphocholine[c] => 1 sn-glycero-3-phosphocholine[c] + 1 H+[c] + 1 a carboxylate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_334
- Source: orthology-esiliculosus
- Gene: Tiso_gene_12478
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_20565
- Source: orthology-esiliculosus
- Gene: Tiso_gene_12479
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_12375
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_8353
- Source: annotation-experimental_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-experimental_annotation
- Gene: Tiso_gene_19778
- Source: annotation-in-silico_annotation
- Assignment: AUTOMATED-NAME-MATCH
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_2505
- Source: orthology-esiliculosus
- Gene: Tiso_gene_15692
- Source: orthology-esiliculosus
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
External links
- RHEA:
- LIGAND-RXN:
- UNIPROT: