Difference between revisions of "CPD0-2117"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15318 CPD-15318] == * smiles: ** C(OP([O-])(=O)[O-])C1(C(O)C(O)C(O)O1) * inchi key: ** InCh...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2117 CPD0-2117] == * smiles: ** CCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD0-2117 CPD0-2117] == |
* smiles: | * smiles: | ||
| − | ** C( | + | ** CCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** trans-hexadec-2-enoyl-CoA |
| + | * inchi key: | ||
| + | ** InChIKey=JUPAQFRKPHPXLD-MSHHSVQMSA-J | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 999.899 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** trans-2-hexadecenoyl-CoA |
| + | ** (2E)-hexadecenoyl-CoA | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[RXN-16540]] |
| − | * [[ | + | * [[ACOA160or]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
| − | |||
== External links == | == External links == | ||
| + | * BIGG : hdd2coa | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46173176 46173176] |
| + | * HMDB : HMDB03945 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C05272 C05272] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61526 61526] |
| − | * METABOLIGHTS : | + | * METABOLIGHTS : MTBLC61526 |
| − | {{#set: smiles=C( | + | {{#set: smiles=CCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O}} |
| − | {{#set: | + | {{#set: common name=trans-hexadec-2-enoyl-CoA}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=JUPAQFRKPHPXLD-MSHHSVQMSA-J}} |
| − | {{#set: molecular weight= | + | {{#set: molecular weight=999.899 }} |
| − | {{#set: common name= | + | {{#set: common name=trans-2-hexadecenoyl-CoA|(2E)-hexadecenoyl-CoA}} |
| − | + | {{#set: produced by=RXN-16540|ACOA160or}} | |
| − | {{#set: produced by= | + | |
| − | + | ||
Latest revision as of 20:57, 21 March 2018
Contents
Metabolite CPD0-2117
- smiles:
- CCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O
- common name:
- trans-hexadec-2-enoyl-CoA
- inchi key:
- InChIKey=JUPAQFRKPHPXLD-MSHHSVQMSA-J
- molecular weight:
- 999.899
- Synonym(s):
- trans-2-hexadecenoyl-CoA
- (2E)-hexadecenoyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : hdd2coa
- PUBCHEM:
- HMDB : HMDB03945
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC61526
"CCCCCCCCCCCCCC=CC(=O)SCCNC(=O)CCNC(C(O)C(C)(C)COP([O-])(=O)OP([O-])(=O)OCC1(C(OP(=O)([O-])[O-])C(O)C(O1)N3(C=NC2(C(N)=NC=NC=23))))=O" cannot be used as a page name in this wiki.
