Difference between revisions of "RXN1F-169"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-GLUCOSE DTDP-DEOH-DEOXY-GLUCOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-169 RXN1F-169] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-GLUCOSE DTDP-DEOH-DEOXY-GLUCOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN1F-169 RXN1F-169] ==
−
* smiles:
+
* direction:
−
** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))
+
** LEFT-TO-RIGHT
−
* common name:
+
* ec number:
−
** dTDP-4-dehydro-6-deoxy-α-D-glucopyranose
+
** [http://enzyme.expasy.org/EC/1.14.11 EC-1.14.11]
−
* inchi key:
+
−
** InChIKey=PSXWNITXWWECNY-UCBTUHGZSA-L
+
−
* molecular weight:
+
−
** 544.302   
+
 
* Synonym(s):
 
* Synonym(s):
−
** TDP-4-keto-6-deoxy--α-D-glucose
 
−
** TDP-4-oxo-6-deoxy--α-D-glucose
 
−
** dTDP-4-oxo-6-deoxy--α-D-glucose
 
−
** dTDP-6-deoxy-α-D-xylo-4-hexosulose
 
−
** dTDP-6-deoxy-α-D-xylohex-4-ulose
 
−
** dTDP-4-dehydro-6-deoxy-α-D-glucose
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[DTDPGLUCDEHYDRAT-RXN]]
+
** 1 [[2-KETOGLUTARATE]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD1F-96]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[CPD1F-140]][c] '''+''' 2 [[CARBON-DIOXIDE]][c] '''+''' 1 [[SUC]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 2-oxoglutarate[c] '''+''' 1 oxygen[c] '''+''' 1 gibberellin A19[c] '''=>''' 1 H+[c] '''+''' 1 gibberellin A20[c] '''+''' 2 CO2[c] '''+''' 1 succinate[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_3330]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-5035]], gibberellin biosynthesis III (early C-13 hydroxylation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-5035 PWY-5035]
 +
** '''3''' reactions found over '''7''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* BIGG : dtdp4d6dg
+
* LIGAND-RXN:
−
* PUBCHEM:
+
** [http://www.genome.jp/dbget-bin/www_bget?R03807 R03807]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244163 25244163]
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* HMDB : HMDB01399
+
{{#set: ec number=EC-1.14.11}}
−
* LIGAND-CPD:
+
{{#set: gene associated=Tiso_gene_3330}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11907 C11907]
+
{{#set: in pathway=PWY-5035}}
−
* CHEBI:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57649 57649]
+
{{#set: reconstruction source=orthology-esiliculosus}}
−
* METABOLIGHTS : MTBLC57649
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))}}
+
−
{{#set: common name=dTDP-4-dehydro-6-deoxy-α-D-glucopyranose}}
+
−
{{#set: inchi key=InChIKey=PSXWNITXWWECNY-UCBTUHGZSA-L}}
+
−
{{#set: molecular weight=544.302    }}
+
−
{{#set: common name=TDP-4-keto-6-deoxy--α-D-glucose|TDP-4-oxo-6-deoxy--α-D-glucose|dTDP-4-oxo-6-deoxy--α-D-glucose|dTDP-6-deoxy-α-D-xylo-4-hexosulose|dTDP-6-deoxy-α-D-xylohex-4-ulose|dTDP-4-dehydro-6-deoxy-α-D-glucose}}
+
−
{{#set: produced by=DTDPGLUCDEHYDRAT-RXN}}
+

Latest revision as of 19:57, 21 March 2018

Reaction RXN1F-169

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-5035, gibberellin biosynthesis III (early C-13 hydroxylation): PWY-5035
    • 3 reactions found over 7 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN1F-169&oldid=44828"