Difference between revisions of "CPD-17422"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-12 RXN66-12] == * direction: ** LEFT-TO-RIGHT * common name: ** 4,4-dimethyl-14α-hydrox...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-12 RXN66-12] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
 
* common name:
 
* common name:
−
** 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol 14-dehydrogenase
+
** 3-dehydro-6-hydroxyteasterone
 +
* inchi key:
 +
** InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N
 +
* molecular weight:
 +
** 448.685   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[PROTON]][c] '''+''' 1 [[NADPH]][c] '''+''' 1 [[OXYGEN-MOLECULE]][c] '''+''' 1 [[CPD-8607]][c] '''=>''' 2 [[WATER]][c] '''+''' 1 [[CPD-8608]][c] '''+''' 1 [[NADP]][c]
+
* [[RXN-11535]]
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H+[c] '''+''' 1 NADPH[c] '''+''' 1 oxygen[c] '''+''' 1 4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol[c] '''=>''' 2 H2O[c] '''+''' 1 4,4-dimethyl-14α-formyl-5α-cholesta-8-en-3β-ol[c] '''+''' 1 NADP+[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_8263]]
+
−
** [[pantograph]]-[[esiliculosus]]
+
−
== Pathways  ==
+
−
* [[PWY66-3]], cholesterol biosynthesis II (via 24,25-dihydrolanosterol): [http://metacyc.org/META/NEW-IMAGE?object=PWY66-3 PWY66-3]
+
−
** '''8''' reactions found over '''22''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[orthology]]:
+
−
** [[pantograph]]:
+
−
*** [[esiliculosus]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=4,4-dimethyl-14α-hydroxymethyl-5α-cholesta-8-en-3β-ol 14-dehydrogenase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102515138 102515138]
−
{{#set: gene associated=Tiso_gene_8263}}
+
{{#set: smiles=CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))}}
−
{{#set: in pathway=PWY66-3}}
+
{{#set: common name=3-dehydro-6-hydroxyteasterone}}
−
{{#set: reconstruction category=orthology}}
+
{{#set: inchi key=InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N}}
−
{{#set: reconstruction tool=pantograph}}
+
{{#set: molecular weight=448.685    }}
−
{{#set: reconstruction source=esiliculosus}}
+
{{#set: produced by=RXN-11535}}

Latest revision as of 19:57, 21 March 2018

Metabolite CPD-17422

  • smiles:
    • CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))
  • common name:
    • 3-dehydro-6-hydroxyteasterone
  • inchi key:
    • InChIKey=VIPVRXUSPSUXNI-XDMMOTQBSA-N
  • molecular weight:
    • 448.685
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-17422&oldid=44844"