Difference between revisions of "L-phenylalanyl-L-arginyl-Protein"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-phenylalanyl-L-arginyl-Protein L-phenylalanyl-L-arginyl-Protein] == * common name: ** L-pheny...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=L-phenylalanyl-L-arginyl-Protein L-phenylalanyl-L-arginyl-Protein] ==
* smiles:
+
** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
* inchi key:
+
** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
+
 
* common name:
 
* common name:
** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
+
** L-phenylalanyl-L-arginyl-[protein]
* molecular weight:
+
** 396.655   
+
 
* Synonym(s):
 
* Synonym(s):
** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
 
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[RXN-11881]]
+
* [[RXN-17847]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=L-phenylalanyl-L-arginyl-[protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514956 102514956]
+
{{#set: produced by=RXN-17847}}
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
{{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}}
+
{{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}}
+
{{#set: molecular weight=396.655    }}
+
{{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}}
+
{{#set: produced by=RXN-11881}}
+

Latest revision as of 19:57, 21 March 2018

Metabolite L-phenylalanyl-L-arginyl-Protein

  • common name:
    • L-phenylalanyl-L-arginyl-[protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"L-phenylalanyl-L-arginyl-[protein" cannot be used as a page name in this wiki.