Difference between revisions of "Holo-EntB"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTURONATE UDP-D-GALACTURONATE] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntB Holo-EntB] == * common name: ** a holo-[EntB isochorismatase/aryl-carrier protein] *...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-D-GALACTURONATE UDP-D-GALACTURONATE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntB Holo-EntB] ==
* smiles:
+
** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))
+
* inchi key:
+
** InChIKey=HDYANYHVCAPMJV-GXNRKQDOSA-K
+
 
* common name:
 
* common name:
** UDP-α-D-galacturonate
+
** a holo-[EntB isochorismatase/aryl-carrier protein]
* molecular weight:
+
** 577.265   
+
 
* Synonym(s):
 
* Synonym(s):
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
* [[UDPGALor]]
+
* [[ENTDB-RXN]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
* [[UDP-GLUCURONATE-4-EPIMERASE-RXN]]
 
 
== External links  ==
 
== External links  ==
* PUBCHEM:
+
{{#set: common name=a holo-[EntB isochorismatase/aryl-carrier protein]}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244587 25244587]
+
{{#set: produced by=ENTDB-RXN}}
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57635 57635]
+
* LIGAND-CPD:
+
** [http://www.genome.jp/dbget-bin/www_bget?C00617 C00617]
+
* HMDB : HMDB12302
+
{{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N3(C=CC(=O)NC(=O)3))}}
+
{{#set: inchi key=InChIKey=HDYANYHVCAPMJV-GXNRKQDOSA-K}}
+
{{#set: common name=UDP-α-D-galacturonate}}
+
{{#set: molecular weight=577.265    }}
+
{{#set: produced by=UDPGALor}}
+
{{#set: reversible reaction associated=UDP-GLUCURONATE-4-EPIMERASE-RXN}}
+

Latest revision as of 19:57, 21 March 2018

Metabolite Holo-EntB

  • common name:
    • a holo-[EntB isochorismatase/aryl-carrier protein]
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"a holo-[EntB isochorismatase/aryl-carrier protein" cannot be used as a page name in this wiki.