Difference between revisions of "CPD-10806"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17422 CPD-17422] == * smiles: ** CC(C)C(C)C(O)C(O)C(C)[CH]3(CC[CH]4([CH]2(CC(O)[CH]1(CC(=O)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] == * smiles: ** CCCCCC(O)[CH]=CC=O * common name: ** 4-hydroxy-2-nonenal *...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD- | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] == |
* smiles: | * smiles: | ||
| − | ** | + | ** CCCCCC(O)[CH]=CC=O |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** 4-hydroxy-2-nonenal |
| + | * inchi key: | ||
| + | ** InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 156.224 |
* Synonym(s): | * Synonym(s): | ||
| + | ** 4HNE | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-13673]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283344 5283344] |
| − | {{#set: smiles= | + | * CHEMSPIDER: |
| − | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.4446465.html 4446465] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: molecular weight= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32585 32585] |
| − | {{#set: | + | * METABOLIGHTS : MTBLC32585 |
| + | * HMDB : HMDB04362 | ||
| + | {{#set: smiles=CCCCCC(O)[CH]=CC=O}} | ||
| + | {{#set: common name=4-hydroxy-2-nonenal}} | ||
| + | {{#set: inchi key=InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N}} | ||
| + | {{#set: molecular weight=156.224 }} | ||
| + | {{#set: common name=4HNE}} | ||
| + | {{#set: consumed by=RXN-13673}} | ||
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite CPD-10806
- smiles:
- CCCCCC(O)[CH]=CC=O
- common name:
- 4-hydroxy-2-nonenal
- inchi key:
- InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N
- molecular weight:
- 156.224
- Synonym(s):
- 4HNE
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCC(O)[CH]=CC=O" cannot be used as a page name in this wiki.
