Difference between revisions of "RXN-14268"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] == * smiles: ** CCCCCC(O)[CH]=CC=O * inchi key: ** InChIKey=JVJFIQYAHPMBBX...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14268 RXN-14268] == * direction: ** LEFT-TO-RIGHT * common name: ** lauroyl-CoA acetyl-CoA acyl...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10806 CPD-10806] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14268 RXN-14268] ==
−
* smiles:
+
* direction:
−
** CCCCCC(O)[CH]=CC=O
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N
+
 
* common name:
 
* common name:
−
** 4-hydroxy-2-nonenal
+
** lauroyl-CoA acetyl-CoA acyltransferase
−
* molecular weight:
+
** thiolase
−
** 156.224   
+
** acetyl-_c-acetyltransferase
 +
** 3-ketoacyl-_thiolase
 +
* ec number:
 +
** [http://enzyme.expasy.org/EC/2.3.1.16 EC-2.3.1.16]
 
* Synonym(s):
 
* Synonym(s):
−
** 4HNE
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[RXN-13673]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[CPD-10284]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[ACETYL-COA]][c] '''+''' 1 [[LAUROYLCOA-CPD]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 3-oxo-myristoyl-CoA[c] '''+''' 1 coenzyme A[c] '''=>''' 1 acetyl-CoA[c] '''+''' 1 lauroyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_10116]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_3855]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_16181]]
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_15327]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_17451]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: EC-NUMBER
 +
* Gene: [[Tiso_gene_3856]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-7654]], (8E,10E)-dodeca-8,10-dienol biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7654 PWY-7654]
 +
** '''6''' reactions found over '''11''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-athaliana]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 +
* Category: [[annotation]]
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Tool: [[pathwaytools]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5283344 5283344]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31093 31093]
−
* CHEMSPIDER:
+
* LIGAND-RXN:
−
** [http://www.chemspider.com/Chemical-Structure.4446465.html 4446465]
+
** [http://www.genome.jp/dbget-bin/www_bget?R03858 R03858]
−
* CHEBI:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32585 32585]
+
{{#set: common name=lauroyl-CoA acetyl-CoA acyltransferase}}
−
* METABOLIGHTS : MTBLC32585
+
{{#set: common name=thiolase}}
−
* HMDB : HMDB04362
+
{{#set: common name=acetyl-_c-acetyltransferase}}
−
{{#set: smiles=CCCCCC(O)[CH]=CC=O}}
+
{{#set: common name=3-ketoacyl-_thiolase}}
−
{{#set: inchi key=InChIKey=JVJFIQYAHPMBBX-FNORWQNLSA-N}}
+
{{#set: ec number=EC-2.3.1.16}}
−
{{#set: common name=4-hydroxy-2-nonenal}}
+
{{#set: gene associated=Tiso_gene_10116|Tiso_gene_3855|Tiso_gene_16181|Tiso_gene_15327|Tiso_gene_17451|Tiso_gene_3856}}
−
{{#set: molecular weight=156.224    }}
+
{{#set: in pathway=PWY-7654}}
−
{{#set: common name=4HNE}}
+
{{#set: reconstruction category=orthology|annotation}}
−
{{#set: consumed by=RXN-13673}}
+
{{#set: reconstruction source=annotation-experimental_annotation|orthology-creinhardtii|annotation-in-silico_annotation|orthology-athaliana|orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph|pathwaytools}}

Latest revision as of 19:57, 21 March 2018

Reaction RXN-14268

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • lauroyl-CoA acetyl-CoA acyltransferase
    • thiolase
    • acetyl-_c-acetyltransferase
    • 3-ketoacyl-_thiolase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 3-oxo-myristoyl-CoA[c] + 1 coenzyme A[c] => 1 acetyl-CoA[c] + 1 lauroyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7654, (8E,10E)-dodeca-8,10-dienol biosynthesis: PWY-7654
    • 6 reactions found over 11 reactions in the full pathway

Reconstruction information

External links






Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-14268&oldid=44859"