Difference between revisions of "CPD-469"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7694 RXN-7694] == * direction: ** LEFT-TO-RIGHT * common name: ** polyketide_synthase ** ORF *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == * smiles: ** CC(=O)NC(C([O-])=O)CC[CH]=O * common name: ** N-acetyl-L-gluta...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == |
− | * | + | * smiles: |
− | ** | + | ** CC(=O)NC(C([O-])=O)CC[CH]=O |
* common name: | * common name: | ||
− | ** | + | ** N-acetyl-L-glutamate 5-semialdehyde |
− | ** | + | * inchi key: |
− | * | + | ** InChIKey=BCPSFKBPHHBDAI-LURJTMIESA-M |
− | ** | + | * molecular weight: |
+ | ** 172.16 | ||
* Synonym(s): | * Synonym(s): | ||
+ | ** N-acetylglutamate γ-semialdehyde | ||
+ | ** N-acetyl-L-glutamate-5-semialdehyde | ||
+ | ** N-acetyl-L-glutamate semialdehyde | ||
+ | ** N-acetylglutamate semialdehyde | ||
+ | ** 2-acetamido-5-oxopentanoate | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[N-ACETYLGLUTPREDUCT-RXN]] | |
− | + | * [[ACETYLORNTRANSAM-RXN]] | |
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | * | + | |
− | + | ||
== External links == | == External links == | ||
− | + | * BIGG : acg5sa | |
− | + | * PUBCHEM: | |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6857435 6857435] | |
− | {{#set: | + | * HMDB : HMDB06488 |
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01250 C01250] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.5256773.html 5256773] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=29123 29123] | ||
+ | * METABOLIGHTS : MTBLC29123 | ||
+ | {{#set: smiles=CC(=O)NC(C([O-])=O)CC[CH]=O}} | ||
+ | {{#set: common name=N-acetyl-L-glutamate 5-semialdehyde}} | ||
+ | {{#set: inchi key=InChIKey=BCPSFKBPHHBDAI-LURJTMIESA-M}} | ||
+ | {{#set: molecular weight=172.16 }} | ||
+ | {{#set: common name=N-acetylglutamate γ-semialdehyde|N-acetyl-L-glutamate-5-semialdehyde|N-acetyl-L-glutamate semialdehyde|N-acetylglutamate semialdehyde|2-acetamido-5-oxopentanoate}} | ||
+ | {{#set: reversible reaction associated=N-ACETYLGLUTPREDUCT-RXN|ACETYLORNTRANSAM-RXN}} |
Latest revision as of 20:57, 21 March 2018
Contents
Metabolite CPD-469
- smiles:
- CC(=O)NC(C([O-])=O)CC[CH]=O
- common name:
- N-acetyl-L-glutamate 5-semialdehyde
- inchi key:
- InChIKey=BCPSFKBPHHBDAI-LURJTMIESA-M
- molecular weight:
- 172.16
- Synonym(s):
- N-acetylglutamate γ-semialdehyde
- N-acetyl-L-glutamate-5-semialdehyde
- N-acetyl-L-glutamate semialdehyde
- N-acetylglutamate semialdehyde
- 2-acetamido-5-oxopentanoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- BIGG : acg5sa
- PUBCHEM:
- HMDB : HMDB06488
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
- METABOLIGHTS : MTBLC29123
"CC(=O)NC(C([O-])=O)CC[CH]=O" cannot be used as a page name in this wiki.