Difference between revisions of "CPD-12321"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Oxo-glutarate-dehydrogenase-DH-lipoyl Oxo-glutarate-dehydrogenase-DH-lipoyl] == * common name:...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12321 CPD-12321] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)...") |
||
| (One intermediate revision by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12321 CPD-12321] == |
| + | * smiles: | ||
| + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C | ||
* common name: | * common name: | ||
| − | ** | + | ** 15-cis-phytoene |
| + | * inchi key: | ||
| + | ** InChIKey=YVLPJIGOMTXXLP-BHLJUDRVSA-N | ||
| + | * molecular weight: | ||
| + | ** 544.946 | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[RXN-12243]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXNARA-8002]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | + | * [[RXN-13323]] | |
| − | * [[RXN- | + | |
== External links == | == External links == | ||
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C05421 C05421] |
| − | {{#set: reversible reaction associated= | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.8138988.html 8138988] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=27787 27787] | ||
| + | * PUBCHEM: | ||
| + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=9963391 9963391] | ||
| + | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C}} | ||
| + | {{#set: common name=15-cis-phytoene}} | ||
| + | {{#set: inchi key=InChIKey=YVLPJIGOMTXXLP-BHLJUDRVSA-N}} | ||
| + | {{#set: molecular weight=544.946 }} | ||
| + | {{#set: consumed by=RXN-12243}} | ||
| + | {{#set: produced by=RXNARA-8002}} | ||
| + | {{#set: reversible reaction associated=RXN-13323}} | ||
Latest revision as of 19:57, 21 March 2018
Contents
Metabolite CPD-12321
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC=CC=C(CCC=C(CCC=C(CCC=C(C)C)C)C)C
- common name:
- 15-cis-phytoene
- inchi key:
- InChIKey=YVLPJIGOMTXXLP-BHLJUDRVSA-N
- molecular weight:
- 544.946
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
