Difference between revisions of "Tiso gene 9613"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-469 CPD-469] == * smiles: ** CC(=O)NC(C([O-])=O)CC[CH]=O * inchi key: ** InChIKey=BCPSFKBPH...") |
(Created page with "Category:Gene == Gene Tiso_gene_9613 == * right end position: ** 12073 * transcription direction: ** POSITIVE * left end position: ** 9624 * centisome position: ** 78.1168...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_9613 == |
− | * | + | * right end position: |
− | ** | + | ** 12073 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 9624 |
− | * | + | * centisome position: |
− | ** | + | ** 78.11688 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[1.14.13.8-RXN]] | |
− | == | + | ** Source: [[annotation-in-silico_annotation]] |
− | * [[ | + | *** Assignment: ec-number |
− | * [[ | + | ** Source: [[orthology-esiliculosus]] |
+ | * Reaction: [[CYCLOHEXANONE-MONOOXYGENASE-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-5961]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | * Reaction: [[RXN66-81]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways associated == | ||
+ | * [[CYCLOHEXANOL-OXIDATION-PWY]] | ||
+ | * [[PWY-5947]] | ||
+ | * [[PWY66-201]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=12073}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=9624}} | |
− | + | {{#set: centisome position=78.11688 }} | |
− | + | {{#set: reaction associated=1.14.13.8-RXN|CYCLOHEXANONE-MONOOXYGENASE-RXN|RXN-5961|RXN66-81}} | |
− | + | {{#set: pathway associated=CYCLOHEXANOL-OXIDATION-PWY|PWY-5947|PWY66-201}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 19:57, 21 March 2018
Gene Tiso_gene_9613
- right end position:
- 12073
- transcription direction:
- POSITIVE
- left end position:
- 9624
- centisome position:
- 78.11688
- Synonym(s):
Reactions associated
- Reaction: 1.14.13.8-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: CYCLOHEXANONE-MONOOXYGENASE-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-5961
- Source: orthology-creinhardtii
- Reaction: RXN66-81
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation