Difference between revisions of "RXN-13616"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] == * smiles: ** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13616 RXN-13616] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-12853 CPD-12853] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-13616 RXN-13616] ==
−
* smiles:
+
* direction:
−
** CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
* ec number:
−
** InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N
+
** [http://enzyme.expasy.org/EC/4.2.1.17 EC-4.2.1.17]
−
* common name:
+
−
** 4α-methyl-5α-cholesta-8,14,24-trien-3β-ol
+
−
* molecular weight:
+
−
** 396.655   
+
 
* Synonym(s):
 
* Synonym(s):
−
** cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN-11881]]
+
** 1 [[T2-DECENOYL-COA]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[CPD0-2244]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 trans-dec-2-enoyl-CoA[c] '''+''' 1 H2O[c] '''=>''' 1 (S)-3-hydroxydecanoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14262]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_6885]]
 +
** Source: [[orthology-esiliculosus]]
 +
* Gene: [[Tiso_gene_16145]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY-7094]], fatty acid salvage: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7094 PWY-7094]
 +
** '''5''' reactions found over '''6''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=102514956 102514956]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31193 31193]
−
{{#set: smiles=CC(C)=CCCC(C)[CH]3(CC=C4(C2(CC[CH]1(C(C)C(O)CCC(C)1C=2CCC(C)34))))}}
+
* LIGAND-RXN:
−
{{#set: inchi key=InChIKey=QJVMEAZHJKXWJD-HESBYNJASA-N}}
+
** [http://www.genome.jp/dbget-bin/www_bget?R04744 R04744]
−
{{#set: common name=4α-methyl-5α-cholesta-8,14,24-trien-3β-ol}}
+
{{#set: direction=LEFT-TO-RIGHT}}
−
{{#set: molecular weight=396.655    }}
+
{{#set: ec number=EC-4.2.1.17}}
−
{{#set: common name=cholesta-8,14,24-trien-3-ol, 4-methyl-, (3β,4α,5α)-}}
+
{{#set: gene associated=Tiso_gene_14262|Tiso_gene_6885|Tiso_gene_16145}}
−
{{#set: produced by=RXN-11881}}
+
{{#set: in pathway=PWY-7094}}
 +
{{#set: reconstruction category=orthology}}
 +
{{#set: reconstruction source=orthology-esiliculosus}}
 +
{{#set: reconstruction tool=pantograph}}

Latest revision as of 20:57, 21 March 2018

Reaction RXN-13616

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 trans-dec-2-enoyl-CoA[c] + 1 H2O[c] => 1 (S)-3-hydroxydecanoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-7094, fatty acid salvage: PWY-7094
    • 5 reactions found over 6 reactions in the full pathway

Reconstruction information

External links




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=RXN-13616&oldid=44891"