Difference between revisions of "Tiso gene 18337"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...")
 
(Created page with "Category:Gene == Gene Tiso_gene_18337 == * right end position: ** 2858 * transcription direction: ** NEGATIVE * left end position: ** 918 * centisome position: ** 29.80519...")
 
(3 intermediate revisions by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] ==
+
== Gene Tiso_gene_18337 ==
−
* smiles:
+
* right end position:
−
** C=C1(C(CC([N+])C([O-])=O)C1)
+
** 2858
−
* inchi key:
+
* transcription direction:
−
** InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N
+
** NEGATIVE
−
* common name:
+
* left end position:
−
** hypoglycin A
+
** 918
−
* molecular weight:
+
* centisome position:
−
** 141.169    
+
** 29.805195    
 
* Synonym(s):
 
* Synonym(s):
−
** hypoglycine
 
−
** hypoglycine A
 
−
** hypoglycin
 
−
** L-β-(methylenecyclopropyl)-alanine
 
−
** 2-amino-3-(2-methylidenecyclopropyl)propanoic acid
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-9157]]
+
* Reaction: [[PYRROLINECARBDEHYDROG-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
* Reaction: [[RXN-14116]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PROUT-PWY]]
 +
* [[ARGASEDEG-PWY]]
 +
* [[PWY-6853]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=2858}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244430 25244430]
+
{{#set: transcription direction=NEGATIVE}}
−
* Wikipedia : Hypoglycin
+
{{#set: left end position=918}}
−
* LIGAND-CPD:
+
{{#set: centisome position=29.805195   }}
−
** [http://www.genome.jp/dbget-bin/www_bget?C08287 C08287]
+
{{#set: reaction associated=PYRROLINECARBDEHYDROG-RXN|RXN-14116}}
−
* HMDB : HMDB29427
+
{{#set: pathway associated=PROUT-PWY|ARGASEDEG-PWY|PWY-6853}}
−
{{#set: smiles=C=C1(C(CC([N+])C([O-])=O)C1)}}
+
−
{{#set: inchi key=InChIKey=OOJZCXFXPZGUBJ-UHFFFAOYSA-N}}
+
−
{{#set: common name=hypoglycin A}}
+
−
{{#set: molecular weight=141.169   }}
+
−
{{#set: common name=hypoglycine|hypoglycine A|hypoglycin|L-β-(methylenecyclopropyl)-alanine|2-amino-3-(2-methylidenecyclopropyl)propanoic acid}}
+
−
{{#set: consumed by=RXN-9157}}
+

Latest revision as of 19:57, 21 March 2018

Gene Tiso_gene_18337

  • right end position:
    • 2858
  • transcription direction:
    • NEGATIVE
  • left end position:
    • 918
  • centisome position:
    • 29.805195
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_18337&oldid=44902"