Difference between revisions of "Tiso gene 18337"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9699 CPD-9699] == * smiles: ** C=C1(C(CC([N+])C([O-])=O)C1) * inchi key: ** InChIKey=OOJZCX...") |
(Created page with "Category:Gene == Gene Tiso_gene_18337 == * right end position: ** 2858 * transcription direction: ** NEGATIVE * left end position: ** 918 * centisome position: ** 29.80519...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_18337 == |
− | * | + | * right end position: |
− | ** | + | ** 2858 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * left end position: |
− | ** | + | ** 918 |
− | * | + | * centisome position: |
− | ** | + | ** 29.805195 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * Reaction: [[PYRROLINECARBDEHYDROG-RXN]] |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | == | + | *** Assignment: ec-number |
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | * Reaction: [[RXN-14116]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PROUT-PWY]] | ||
+ | * [[ARGASEDEG-PWY]] | ||
+ | * [[PWY-6853]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=2858}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: left end position=918}} | |
− | + | {{#set: centisome position=29.805195 }} | |
− | + | {{#set: reaction associated=PYRROLINECARBDEHYDROG-RXN|RXN-14116}} | |
− | + | {{#set: pathway associated=PROUT-PWY|ARGASEDEG-PWY|PWY-6853}} | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:57, 21 March 2018
Gene Tiso_gene_18337
- right end position:
- 2858
- transcription direction:
- NEGATIVE
- left end position:
- 918
- centisome position:
- 29.805195
- Synonym(s):
Reactions associated
- Reaction: PYRROLINECARBDEHYDROG-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation
- Reaction: RXN-14116
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: annotation-in-silico_annotation