|
|
(2 intermediate revisions by the same user not shown) |
Line 1: |
Line 1: |
− | [[Category:Reaction]] | + | [[Category:Metabolite]] |
− | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACSERLY-RXN ACSERLY-RXN] == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == |
− | * direction: | + | * smiles: |
− | ** REVERSIBLE | + | ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) |
| * common name: | | * common name: |
− | ** cysteine_synthase | + | ** β-L-arabinose 1-phosphate |
− | ** cog0031:_cysteine_synthase | + | * inchi key: |
− | ** cysteine | + | ** InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L |
− | * ec number: | + | * molecular weight: |
− | ** [http://enzyme.expasy.org/EC/2.5.1.47 EC-2.5.1.47] | + | ** 228.095 |
| * Synonym(s): | | * Synonym(s): |
| + | ** β-L-arabinose 1-P |
| | | |
− | == Reaction Formula == | + | == Reaction(s) known to consume the compound == |
− | * With identifiers:
| + | * [[UMPU]] |
− | ** 1 [[HS]][c] '''+''' 1 [[ACETYLSERINE]][c] '''<=>''' 1 [[CYS]][c] '''+''' 1 [[ACET]][c] '''+''' 1 [[PROTON]][c]
| + | == Reaction(s) known to produce the compound == |
− | * With common name(s):
| + | == Reaction(s) of unknown directionality == |
− | ** 1 hydrogen sulfide[c] '''+''' 1 O-acetyl-L-serine[c] '''<=>''' 1 L-cysteine[c] '''+''' 1 acetate[c] '''+''' 1 H+[c]
| + | |
− | | + | |
− | == Genes associated with this reaction == | + | |
− | Genes have been associated with this reaction based on different elements listed below.
| + | |
− | * [[Tiso_gene_17043]] | + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_7852]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | * [[Tiso_gene_12184]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_2283]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_819]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | * [[Tiso_gene_6110]]
| + | |
− | ** IN-SILICO_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** EXPERIMENTAL_ANNOTATION
| + | |
− | ***EC-NUMBER
| + | |
− | ** [[pantograph]]-[[synechocystis]]
| + | |
− | ** [[pantograph]]-[[esiliculosus]]
| + | |
− | ** [[pantograph]]-[[creinhardtii]]
| + | |
− | == Pathways == | + | |
− | * [[CYSTSYN-PWY]], L-cysteine biosynthesis I: [http://metacyc.org/META/NEW-IMAGE?object=CYSTSYN-PWY CYSTSYN-PWY]
| + | |
− | ** '''2''' reactions found over '''2''' reactions in the full pathway
| + | |
− | == Reconstruction information == | + | |
− | * [[orthology]]:
| + | |
− | ** [[pantograph]]:
| + | |
− | *** [[creinhardtii]]
| + | |
− | *** [[synechocystis]]
| + | |
− | *** [[esiliculosus]]
| + | |
− | * [[manual]]:
| + | |
− | ** [[primary_network]]
| + | |
− | * [[annotation]]:
| + | |
− | ** [[pathwaytools]]:
| + | |
− | *** [[experimental_annotation]]
| + | |
− | *** [[in-silico_annotation]]
| + | |
| == External links == | | == External links == |
− | * RHEA: | + | * PUBCHEM: |
− | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=14829 14829] | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244737 25244737] |
− | * LIGAND-RXN: | + | * HMDB : HMDB12195 |
− | ** [http://www.genome.jp/dbget-bin/www_bget?R00897 R00897] | + | * CHEBI: |
− | * UNIPROT:
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57521 57521] |
− | ** [http://www.uniprot.org/uniprot/P31300 P31300] | + | * LIGAND-CPD: |
− | ** [http://www.uniprot.org/uniprot/Q43153 Q43153]
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03906 C03906] |
− | ** [http://www.uniprot.org/uniprot/O67507 O67507]
| + | {{#set: smiles=C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)}} |
− | ** [http://www.uniprot.org/uniprot/P47998 P47998] | + | {{#set: common name=β-L-arabinose 1-phosphate}} |
− | ** [http://www.uniprot.org/uniprot/Q9V1Q3 Q9V1Q3] | + | {{#set: inchi key=InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L}} |
− | ** [http://www.uniprot.org/uniprot/Q9RW80 Q9RW80]
| + | {{#set: molecular weight=228.095 }} |
− | ** [http://www.uniprot.org/uniprot/P56067 P56067]
| + | {{#set: common name=β-L-arabinose 1-P}} |
− | ** [http://www.uniprot.org/uniprot/P63873 P63873]
| + | {{#set: consumed by=UMPU}} |
− | ** [http://www.uniprot.org/uniprot/Q9CI26 Q9CI26]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9ZMW6 Q9ZMW6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P45040 P45040]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9WZD3 Q9WZD3]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9CHF0 Q9CHF0]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A534 P0A534]
| + | |
− | ** [http://www.uniprot.org/uniprot/P71128 P71128]
| + | |
− | ** [http://www.uniprot.org/uniprot/O05393 O05393]
| + | |
− | ** [http://www.uniprot.org/uniprot/O34476 O34476]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9JQL6 Q9JQL6]
| + | |
− | ** [http://www.uniprot.org/uniprot/P38076 P38076]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q7M1J2 Q7M1J2]
| + | |
− | ** [http://www.uniprot.org/uniprot/P29848 P29848]
| + | |
− | ** [http://www.uniprot.org/uniprot/P32260 P32260]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q00834 Q00834]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43317 Q43317]
| + | |
− | ** [http://www.uniprot.org/uniprot/P47999 P47999]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43726 Q43726]
| + | |
− | ** [http://www.uniprot.org/uniprot/P80608 P80608]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59447 Q59447]
| + | |
− | ** [http://www.uniprot.org/uniprot/P53206 P53206]
| + | |
− | ** [http://www.uniprot.org/uniprot/P37887 P37887]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q59529 Q59529]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0A1E3 P0A1E3]
| + | |
− | ** [http://www.uniprot.org/uniprot/P0ABK5 P0ABK5]
| + | |
− | ** [http://www.uniprot.org/uniprot/P16703 P16703]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81154 O81154]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81155 O81155]
| + | |
− | ** [http://www.uniprot.org/uniprot/O81523 O81523]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q93244 Q93244]
| + | |
− | ** [http://www.uniprot.org/uniprot/O45679 O45679]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S2H1 Q9S2H1]
| + | |
− | ** [http://www.uniprot.org/uniprot/P87131 P87131]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9XDU7 Q9XDU7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9UWP0 Q9UWP0]
| + | |
− | ** [http://www.uniprot.org/uniprot/O32978 O32978]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9RAS8 Q9RAS8]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S757 Q9S757]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9S6Z7 Q9S6Z7]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q43725 Q43725]
| + | |
− | ** [http://www.uniprot.org/uniprot/Q9SMY4 Q9SMY4]
| + | |
− | {{#set: direction=REVERSIBLE}} | + | |
− | {{#set: common name=cysteine_synthase}}
| + | |
− | {{#set: common name=cog0031:_cysteine_synthase}} | + | |
− | {{#set: common name=cysteine}}
| + | |
− | {{#set: ec number=EC-2.5.1.47}}
| + | |
− | {{#set: gene associated=Tiso_gene_17043|Tiso_gene_7852|Tiso_gene_12184|Tiso_gene_2283|Tiso_gene_819|Tiso_gene_6110}} | + | |
− | {{#set: in pathway=CYSTSYN-PWY}}
| + | |
− | {{#set: reconstruction category=orthology}} | + | |
− | {{#set: reconstruction tool=pantograph}} | + | |
− | {{#set: reconstruction source=creinhardtii|synechocystis|esiliculosus}} | + | |
− | {{#set: reconstruction category=manual}}
| + | |
− | {{#set: reconstruction source=primary_network}}
| + | |
− | {{#set: reconstruction category=annotation}}
| + | |
− | {{#set: reconstruction tool=pathwaytools}}
| + | |
− | {{#set: reconstruction source=experimental_annotation|in-silico_annotation}}
| + | |