Difference between revisions of "CPD-1825"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALPMUT-RXN GALPMUT-RXN] == * direction: ** REVERSIBLE * common name: ** ORF ** udp-galactopyranose...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] == * smiles: ** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O) * common name: ** β...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GALPMUT-RXN GALPMUT-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1825 CPD-1825] ==
−
* direction:
+
* smiles:
−
** REVERSIBLE
+
** C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)
 
* common name:
 
* common name:
−
** ORF
+
** β-L-arabinose 1-phosphate
−
** udp-galactopyranose_mutase
+
* inchi key:
−
* ec number:
+
** InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L
−
** [http://enzyme.expasy.org/EC/5.4.99.9 EC-5.4.99.9]
+
* molecular weight:
 +
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
 +
** β-L-arabinose 1-P
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[UMPU]]
−
** 1 [[CPD-14553]][c] '''<=>''' 1 [[UDP-D-GALACTO-14-FURANOSE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 UDP-&alpha;-D-galactose[c] '''<=>''' 1 UDP-&alpha;-D-galactofuranose[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Tiso_gene_15395]]
+
−
** IN-SILICO_ANNOTATION
+
−
***AUTOMATED-NAME-MATCH
+
−
* [[Tiso_gene_3775]]
+
−
** IN-SILICO_ANNOTATION
+
−
***EC-NUMBER
+
−
** EXPERIMENTAL_ANNOTATION
+
−
***EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6397]], mycolyl-arabinogalactan-peptidoglycan complex biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6397 PWY-6397]
+
−
** '''2''' reactions found over '''17''' reactions in the full pathway
+
−
* [[OANTIGEN-PWY]], O-antigen building blocks biosynthesis (E. coli): [http://metacyc.org/META/NEW-IMAGE?object=OANTIGEN-PWY OANTIGEN-PWY]
+
−
** '''3''' reactions found over '''5''' reactions in the full pathway
+
−
* [[PWY-7328]], superpathway of UDP-glucose-derived O-antigen building blocks biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7328 PWY-7328]
+
−
** '''5''' reactions found over '''10''' reactions in the full pathway
+
−
* [[PWY-7622]], UDP-galactofuranose biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-7622 PWY-7622]
+
−
** '''2''' reactions found over '''3''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
−
** Source: [[annotation-experimental_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
* RHEA:
+
* PUBCHEM:
−
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=24132 24132]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244737 25244737]
−
* LIGAND-RXN:
+
* HMDB : HMDB12195
−
** [http://www.genome.jp/dbget-bin/www_bget?R00505 R00505]
+
* CHEBI:
−
* UNIPROT:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57521 57521]
−
** [http://www.uniprot.org/uniprot/Q9PML8 Q9PML8]
+
* LIGAND-CPD:
−
{{#set: direction=REVERSIBLE}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C03906 C03906]
−
{{#set: common name=ORF}}
+
{{#set: smiles=C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)}}
−
{{#set: common name=udp-galactopyranose_mutase}}
+
{{#set: common name=&beta;-L-arabinose 1-phosphate}}
−
{{#set: ec number=EC-5.4.99.9}}
+
{{#set: inchi key=InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L}}
−
{{#set: gene associated=Tiso_gene_15395|Tiso_gene_3775}}
+
{{#set: molecular weight=228.095    }}
−
{{#set: in pathway=PWY-6397|OANTIGEN-PWY|PWY-7328|PWY-7622}}
+
{{#set: common name=&beta;-L-arabinose 1-P}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: consumed by=UMPU}}
−
{{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+

Latest revision as of 19:57, 21 March 2018

Metabolite CPD-1825

  • smiles:
    • C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)
  • common name:
    • β-L-arabinose 1-phosphate
  • inchi key:
    • InChIKey=ILXHFXFPPZGENN-QMKXCQHVSA-L
  • molecular weight:
    • 228.095
  • Synonym(s):
    • β-L-arabinose 1-P

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"C1(OC(C(C(C1O)O)O)OP([O-])([O-])=O)" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CPD-1825&oldid=44911"