Difference between revisions of "CPD-15633"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_18337 == * left end position: ** 918 * transcription direction: ** NEGATIVE * right end position: ** 2858 * centisome position: ** 29.80519...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15633 CPD-15633] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** aldehy...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15633 CPD-15633] == |
− | * | + | * smiles: |
− | ** | + | ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] |
− | * | + | * common name: |
− | ** | + | ** aldehydo-D-galacturonate |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=IAJILQKETJEXLJ-RSJOWCBRSA-M |
− | * | + | * molecular weight: |
− | ** | + | ** 193.133 |
* Synonym(s): | * Synonym(s): | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[GALACTUROISOM-RXN]] | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=1593918 1593918] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=12952 12952] |
− | {{#set: reaction associated= | + | {{#set: smiles=[CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]}} |
− | + | {{#set: common name=aldehydo-D-galacturonate}} | |
+ | {{#set: inchi key=InChIKey=IAJILQKETJEXLJ-RSJOWCBRSA-M}} | ||
+ | {{#set: molecular weight=193.133 }} | ||
+ | {{#set: reversible reaction associated=GALACTUROISOM-RXN}} |
Latest revision as of 20:57, 21 March 2018
Contents
Metabolite CPD-15633
- smiles:
- [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-]
- common name:
- aldehydo-D-galacturonate
- inchi key:
- InChIKey=IAJILQKETJEXLJ-RSJOWCBRSA-M
- molecular weight:
- 193.133
- Synonym(s):
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-" cannot be used as a page name in this wiki.