Difference between revisions of "UG6PGTn"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-D-GALACTOSE DTDP-D-GALACTOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=UG6PGTn UG6PGTn] == * direction: ** LEFT-TO-RIGHT * common name: ** UDPglucose:D-glucose-6-phosphat...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-D-GALACTOSE DTDP-D-GALACTOSE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=UG6PGTn UG6PGTn] ==
−
* smiles:
+
* direction:
−
** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(CO)C(O)C(O)C(O)2))O3))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=YSYKRGRSMLTJNL-OAOVJFGZSA-L
+
 
* common name:
 
* common name:
−
** dTDP-α-D-galactose
+
** UDPglucose:D-glucose-6-phosphate 1-alpha-D-glucosyltransferase, nucleus
−
* molecular weight:
+
−
** 562.317   
+
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
== Reaction(s) of unknown directionality ==
+
** 1.0 [[CPD-12575]][n] '''+''' 1.0 [[ALPHA-GLC-6-P]][n] '''=>''' 1.0 [[UDP]][n] '''+''' 1.0 [[TREHALOSE-6P]][n] '''+''' 1.0 [[PROTON]][n]
−
* [[R02984]]
+
* With common name(s):
 +
** 1.0 UDP-α-D-glucose[n] '''+''' 1.0 α-D-glucose 6-phosphate[n] '''=>''' 1.0 UDP[n] '''+''' 1.0 α,α-trehalose 6-phosphate[n] '''+''' 1.0 H+[n]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_14220]]
 +
** Source: [[orthology-creinhardtii]]
 +
* Gene: [[Tiso_gene_18196]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200820 25200820]
+
{{#set: common name=UDPglucose:D-glucose-6-phosphate 1-alpha-D-glucosyltransferase, nucleus}}
−
* CHEBI:
+
{{#set: gene associated=Tiso_gene_14220|Tiso_gene_18196}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15848 15848]
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=orthology}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C02097 C02097]
+
{{#set: reconstruction source=orthology-creinhardtii}}
−
* HMDB : HMDB06876
+
{{#set: reconstruction tool=pantograph}}
−
{{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(CO)C(O)C(O)C(O)2))O3))}}
+
−
{{#set: inchi key=InChIKey=YSYKRGRSMLTJNL-OAOVJFGZSA-L}}
+
−
{{#set: common name=dTDP-α-D-galactose}}
+
−
{{#set: molecular weight=562.317    }}
+
−
{{#set: reversible reaction associated=R02984}}
+

Latest revision as of 20:58, 21 March 2018

Reaction UG6PGTn

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • UDPglucose:D-glucose-6-phosphate 1-alpha-D-glucosyltransferase, nucleus
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 UDP-α-D-glucose[n] + 1.0 α-D-glucose 6-phosphate[n] => 1.0 UDP[n] + 1.0 α,α-trehalose 6-phosphate[n] + 1.0 H+[n]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=UG6PGTn&oldid=44960"