Difference between revisions of "Tiso gene 2954"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-499 CPD-499] == * smiles: ** CC(O)(CCOP(=O)([O-])[O-])CC(=O)[O-] * inchi key: ** InChIKey=O...") |
(Created page with "Category:Gene == Gene Tiso_gene_2954 == * right end position: ** 10803 * transcription direction: ** POSITIVE * left end position: ** 9251 * centisome position: ** 51.6066...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_2954 == |
− | * | + | * right end position: |
− | ** | + | ** 10803 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 9251 |
− | * | + | * centisome position: |
− | ** | + | ** 51.606606 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[RXN0-305]] | |
− | + | ** Source: [[annotation-in-silico_annotation]] | |
− | * [[ | + | *** Assignment: automated-name-match |
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=10803}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=9251}} | |
− | + | {{#set: centisome position=51.606606 }} | |
− | + | {{#set: reaction associated=RXN0-305}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | + |
Latest revision as of 19:58, 21 March 2018
Gene Tiso_gene_2954
- right end position:
- 10803
- transcription direction:
- POSITIVE
- left end position:
- 9251
- centisome position:
- 51.606606
- Synonym(s):
Reactions associated
- Reaction: RXN0-305
- Source: annotation-in-silico_annotation
- Assignment: automated-name-match
- Source: annotation-in-silico_annotation