Difference between revisions of "N-FORMYLKYNURENINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15633 CPD-15633] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * inchi key: ** InChIKey...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == * smiles: ** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == |
* smiles: | * smiles: | ||
| − | ** [CH](=O) | + | ** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-]) |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** N-formylkynurenine |
| + | * inchi key: | ||
| + | ** InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N | ||
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 236.227 |
* Synonym(s): | * Synonym(s): | ||
| + | ** N-Formyl-L-kynurenine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[ARYLFORMAMIDASE-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | |||
== External links == | == External links == | ||
| + | * CAS : 1022-31-7 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202092 25202092] |
| + | * HMDB : HMDB60485 | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58629 58629] |
| − | {{#set: smiles=[CH](=O) | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C02700 C02700] |
| − | {{#set: | + | {{#set: smiles=[CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])}} |
| − | {{#set: molecular weight= | + | {{#set: common name=N-formylkynurenine}} |
| − | {{#set: consumed | + | {{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N}} |
| + | {{#set: molecular weight=236.227 }} | ||
| + | {{#set: common name=N-Formyl-L-kynurenine}} | ||
| + | {{#set: consumed by=ARYLFORMAMIDASE-RXN}} | ||
Latest revision as of 19:58, 21 March 2018
Contents
Metabolite N-FORMYLKYNURENINE
- smiles:
- [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])
- common name:
- N-formylkynurenine
- inchi key:
- InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N
- molecular weight:
- 236.227
- Synonym(s):
- N-Formyl-L-kynurenine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])" cannot be used as a page name in this wiki.
