Difference between revisions of "CPD-14704"

Latest revision as of 20:58, 21 March 2018

"CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O" cannot be used as a page name in this wiki.

@@ Line 1: / Line 1: @@
-[[Category:Gene]]
+[[Category:Metabolite]]
-== Gene Tiso_gene_16936 ==
+== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14704 CPD-14704] ==
-* left end position:
+* smiles:
-** 82
+** CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O
-* transcription direction:
+* common name:
-** POSITIVE
+** 4-hydroxy-2-nonenal-glutathione conjugate
-* right end position:
+* inchi key:
-** 1881
+** InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M
-* centisome position:
+* molecular weight:
-** 2.0352445
+** 462.537
 * Synonym(s):
-== Reactions associated ==
+== Reaction(s) known to consume the compound ==
-* [[2.1.1.77-RXN]]
+== Reaction(s) known to produce the compound ==
-** in-silico_annotation
+* [[RXN-13673]]
-***ec-number
+== Reaction(s) of unknown directionality ==
-** [[pantograph]]-[[esiliculosus]]
-== Pathways associated ==
 == External links  ==
-{{#set: left end position=82}}
+* PUBCHEM:
-{{#set: transcription direction=POSITIVE}}
+** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657725 90657725]
-{{#set: right end position=1881}}
+{{#set: smiles=CCCCCC(O)C(C[CH]=O)SCC(NC(=O)CCC([N+])C(=O)[O-])C(=O)NCC([O-])=O}}
-{{#set: centisome position=2.0352445    }}
+{{#set: common name=4-hydroxy-2-nonenal-glutathione conjugate}}
-{{#set: reaction associated=2.1.1.77-RXN}}
+{{#set: inchi key=InChIKey=NOKRNJLENDLSKM-UHFFFAOYSA-M}}
+{{#set: molecular weight=462.537    }}
+{{#set: produced by=RXN-13673}}