Difference between revisions of "ACCOAtm"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15633 CPD-15633] == * smiles: ** [CH](=O)C(O)C(O)C(O)C(O)C(=O)[O-] * common name: ** aldehy...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACCOAtm ACCOAtm] == * direction: ** REVERSIBLE * common name: ** Acetyl-CoA:CoA antiporter, mitocho...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=ACCOAtm ACCOAtm] == |
− | * | + | * direction: |
− | ** | + | ** REVERSIBLE |
* common name: | * common name: | ||
− | ** | + | ** Acetyl-CoA:CoA antiporter, mitochondrial |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1.0 [[ACETYL-COA]][c] '''+''' 1.0 [[CO-A]][m] '''<=>''' 1.0 [[CO-A]][c] '''+''' 1.0 [[ACETYL-COA]][m] |
− | * [[ | + | * With common name(s): |
+ | ** 1.0 acetyl-CoA[c] '''+''' 1.0 coenzyme A[m] '''<=>''' 1.0 coenzyme A[c] '''+''' 1.0 acetyl-CoA[m] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_9173]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways == | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | *** Tool: [[pantograph]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=REVERSIBLE}} | |
− | + | {{#set: common name=Acetyl-CoA:CoA antiporter, mitochondrial}} | |
− | + | {{#set: gene associated=Tiso_gene_9173}} | |
− | + | {{#set: in pathway=}} | |
− | {{#set: | + | {{#set: reconstruction category=orthology}} |
− | {{#set: | + | {{#set: reconstruction source=orthology-creinhardtii}} |
− | {{#set: | + | {{#set: reconstruction tool=pantograph}} |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:58, 21 March 2018
Contents
Reaction ACCOAtm
- direction:
- REVERSIBLE
- common name:
- Acetyl-CoA:CoA antiporter, mitochondrial
- Synonym(s):
Reaction Formula
- With identifiers:
- 1.0 ACETYL-COA[c] + 1.0 CO-A[m] <=> 1.0 CO-A[c] + 1.0 ACETYL-COA[m]
- With common name(s):
- 1.0 acetyl-CoA[c] + 1.0 coenzyme A[m] <=> 1.0 coenzyme A[c] + 1.0 acetyl-CoA[m]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_9173
- Source: orthology-creinhardtii
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-creinhardtii
- Tool: pantograph
- Source: orthology-creinhardtii