Difference between revisions of "CORTISONE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10618 RXN-10618] == * direction: ** LEFT-TO-RIGHT * common name: ** exostosin_family_protein *...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CORTISONE CORTISONE] == * smiles: ** CC34([CH]2(C(=O)CC1(C)([CH](CCC(C(=O)CO)(O)1)[CH]2CCC3=CC(...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-10618 RXN-10618] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CORTISONE CORTISONE] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CC34([CH]2(C(=O)CC1(C)([CH](CCC(C(=O)CO)(O)1)[CH]2CCC3=CC(=O)CC4)))
 
* common name:
 
* common name:
−
** exostosin_family_protein
+
** cortisone
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.4.1.17 EC-2.4.1.17]
+
** InChIKey=MFYSYFVPBJMHGN-ZPOLXVRWSA-N
 +
* molecular weight:
 +
** 360.449   
 
* Synonym(s):
 
* Synonym(s):
 +
** tetrahydrocortisone
 +
** adreson
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[CPD-11404]][c] '''+''' 1 [[UDP-GLUCURONATE]][c] '''=>''' 1 [[CPD-11412]][c] '''+''' 1 [[UDP]][c]
+
== Reaction(s) of unknown directionality ==
−
* With common name(s):
+
* [[CORTISONE-ALPHA-REDUCTASE-RXN]]
−
** 1 3,3',5-triiodothyroacetate[c] '''+''' 1 UDP-α-D-glucuronate[c] '''=>''' 1 triiodothyroacetate ester glucuronide[c] '''+''' 1 UDP[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_14141]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
* Gene: [[Tiso_gene_14140]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
* [[PWY-6261]], thyroid hormone metabolism II (via conjugation and/or degradation): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6261 PWY-6261]
+
−
** '''11''' reactions found over '''15''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CAS : 53-06-5
−
{{#set: common name=exostosin_family_protein}}
+
* PUBCHEM:
−
{{#set: ec number=EC-2.4.1.17}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=222786 222786]
−
{{#set: gene associated=Tiso_gene_14141|Tiso_gene_14140}}
+
* LIGAND-CPD:
−
{{#set: in pathway=PWY-6261}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C00762 C00762]
−
{{#set: reconstruction category=annotation}}
+
* CHEMSPIDER:
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
** [http://www.chemspider.com/Chemical-Structure.454849.html 454849]
−
{{#set: reconstruction tool=pathwaytools}}
+
* CHEBI:
 +
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16962 16962]
 +
* METABOLIGHTS : MTBLC16962
 +
{{#set: smiles=CC34([CH]2(C(=O)CC1(C)([CH](CCC(C(=O)CO)(O)1)[CH]2CCC3=CC(=O)CC4)))}}
 +
{{#set: common name=cortisone}}
 +
{{#set: inchi key=InChIKey=MFYSYFVPBJMHGN-ZPOLXVRWSA-N}}
 +
{{#set: molecular weight=360.449    }}
 +
{{#set: common name=tetrahydrocortisone|adreson}}
 +
{{#set: reversible reaction associated=CORTISONE-ALPHA-REDUCTASE-RXN}}

Latest revision as of 19:58, 21 March 2018

Metabolite CORTISONE

  • smiles:
    • CC34([CH]2(C(=O)CC1(C)([CH](CCC(C(=O)CO)(O)1)[CH]2CCC3=CC(=O)CC4)))
  • common name:
    • cortisone
  • inchi key:
    • InChIKey=MFYSYFVPBJMHGN-ZPOLXVRWSA-N
  • molecular weight:
    • 360.449
  • Synonym(s):
    • tetrahydrocortisone
    • adreson

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC34([CH]2(C(=O)CC1(C)([CH](CCC(C(=O)CO)(O)1)[CH]2CCC3=CC(=O)CC4)))" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=CORTISONE&oldid=45022"