Difference between revisions of "TRNA-with-7-aminomethyl-7-deazaguanine"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == * smiles: ** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-with-7-aminomethyl-7-deazaguanine tRNA-with-7-aminomethyl-7-deazaguanine] == * common name...")
 
(2 intermediate revisions by the same user not shown)
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=tRNA-with-7-aminomethyl-7-deazaguanine tRNA-with-7-aminomethyl-7-deazaguanine] ==
−
* smiles:
+
−
** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])
+
−
* inchi key:
+
−
** InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N
+
 
* common name:
 
* common name:
−
** N-formylkynurenine
+
** a 7-aminomethyl-7-deazaguanosine34 in tRNA
−
* molecular weight:
+
−
** 236.227   
+
 
* Synonym(s):
 
* Synonym(s):
−
** N-Formyl-L-kynurenine
+
** a 7-aminomethyl-7-deazaguanine at position 34 of a tRNA containing GUN anticodon
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
−
* [[ARYLFORMAMIDASE-RXN]]
+
* [[RXN0-1342]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
 +
* [[RXN0-1321]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 
== External links  ==
 
== External links  ==
−
* CAS : 1022-31-7
+
{{#set: common name=a 7-aminomethyl-7-deazaguanosine34 in tRNA}}
−
* PUBCHEM:
+
{{#set: common name=a 7-aminomethyl-7-deazaguanine at position 34 of a tRNA containing GUN anticodon}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202092 25202092]
+
{{#set: consumed by=RXN0-1342}}
−
* CHEBI:
+
{{#set: produced by=RXN0-1321}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58629 58629]
+
−
* LIGAND-CPD:
+
−
** [http://www.genome.jp/dbget-bin/www_bget?C02700 C02700]
+
−
* HMDB : HMDB60485
+
−
{{#set: smiles=[CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])}}
+
−
{{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N}}
+
−
{{#set: common name=N-formylkynurenine}}
+
−
{{#set: molecular weight=236.227    }}
+
−
{{#set: common name=N-Formyl-L-kynurenine}}
+
−
{{#set: consumed by=ARYLFORMAMIDASE-RXN}}
+

Latest revision as of 19:58, 21 March 2018

Metabolite tRNA-with-7-aminomethyl-7-deazaguanine

  • common name:
    • a 7-aminomethyl-7-deazaguanosine34 in tRNA
  • Synonym(s):
    • a 7-aminomethyl-7-deazaguanine at position 34 of a tRNA containing GUN anticodon

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=TRNA-with-7-aminomethyl-7-deazaguanine&oldid=45025"