Difference between revisions of "GTP-CYCLOHYDRO-II-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=D-GLUCARATE D-GLUCARATE] == * smiles: ** C(=O)(C(O)C(O)C(O)C(O)C(=O)[O-])[O-] * inchi key: ** I...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTP-CYCLOHYDRO-II-RXN GTP-CYCLOHYDRO-II-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** rib...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GTP-CYCLOHYDRO-II-RXN GTP-CYCLOHYDRO-II-RXN] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** riboflavin_biosynthesis_protein |
− | * | + | ** ORF |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/3.5.4.25 EC-3.5.4.25] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | == | + | * With identifiers: |
− | == | + | ** 1 [[GTP]][c] '''+''' 3 [[WATER]][c] '''=>''' 1 [[DIAMINO-OH-PHOSPHORIBOSYLAMINO-PYR]][c] '''+''' 2 [[PROTON]][c] '''+''' 1 [[PPI]][c] '''+''' 1 [[FORMATE]][c] |
− | * [[ | + | * With common name(s): |
+ | ** 1 GTP[c] '''+''' 3 H2O[c] '''=>''' 1 2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one[c] '''+''' 2 H+[c] '''+''' 1 diphosphate[c] '''+''' 1 formate[c] | ||
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_14275]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | * Gene: [[Tiso_gene_19932]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Gene: [[Tiso_gene_8035]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | == Pathways == | ||
+ | * [[PWY-7539]], 6-hydroxymethyl-dihydropterin diphosphate biosynthesis III (Chlamydia): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7539 PWY-7539] | ||
+ | ** '''4''' reactions found over '''5''' reactions in the full pathway | ||
+ | * [[PWY-6168]], flavin biosynthesis III (fungi): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6168 PWY-6168] | ||
+ | ** '''6''' reactions found over '''9''' reactions in the full pathway | ||
+ | * [[RIBOSYN2-PWY]], flavin biosynthesis I (bacteria and plants): [http://metacyc.org/META/NEW-IMAGE?object=RIBOSYN2-PWY RIBOSYN2-PWY] | ||
+ | ** '''7''' reactions found over '''9''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * LIGAND-RXN: |
− | * | + | ** [http://www.genome.jp/dbget-bin/www_bget?R00425 R00425] |
− | * | + | * UNIPROT: |
− | ** [http:// | + | ** [http://www.uniprot.org/uniprot/P0A7I7 P0A7I7] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PNU4 Q9PNU4] |
− | * | + | ** [http://www.uniprot.org/uniprot/O08315 O08315] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O66679 O66679] |
− | * | + | ** [http://www.uniprot.org/uniprot/Q9PHU4 Q9PHU4] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/O25484 O25484] |
− | * | + | ** [http://www.uniprot.org/uniprot/P0A5V0 P0A5V0] |
− | ** [http://www. | + | ** [http://www.uniprot.org/uniprot/P0A7I8 P0A7I8] |
− | * | + | ** [http://www.uniprot.org/uniprot/P43525 P43525] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P17620 P17620] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P38066 P38066] |
− | {{#set: common name= | + | ** [http://www.uniprot.org/uniprot/P50139 P50139] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P74104 P74104] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/O24019 O24019] |
− | {{#set: | + | ** [http://www.uniprot.org/uniprot/P51695 P51695] |
+ | ** [http://www.uniprot.org/uniprot/P50855 P50855] | ||
+ | {{#set: direction=LEFT-TO-RIGHT}} | ||
+ | {{#set: common name=riboflavin_biosynthesis_protein}} | ||
+ | {{#set: common name=ORF}} | ||
+ | {{#set: ec number=EC-3.5.4.25}} | ||
+ | {{#set: gene associated=Tiso_gene_14275|Tiso_gene_19932|Tiso_gene_8035}} | ||
+ | {{#set: in pathway=PWY-7539|PWY-6168|RIBOSYN2-PWY}} | ||
+ | {{#set: reconstruction category=orthology|annotation}} | ||
+ | {{#set: reconstruction source=orthology-athaliana|annotation-in-silico_annotation|orthology-synechocystis|orthology-esiliculosus}} | ||
+ | {{#set: reconstruction tool=pantograph|pathwaytools}} |
Latest revision as of 20:58, 21 March 2018
Contents
Reaction GTP-CYCLOHYDRO-II-RXN
- direction:
- LEFT-TO-RIGHT
- common name:
- riboflavin_biosynthesis_protein
- ORF
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- With common name(s):
- 1 GTP[c] + 3 H2O[c] => 1 2,5-diamino-6-(5-phospho-D-ribosylamino)pyrimidin-4(3H)-one[c] + 2 H+[c] + 1 diphosphate[c] + 1 formate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_14275
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: annotation-in-silico_annotation
- Gene: Tiso_gene_19932
- Source: orthology-athaliana
- Source: orthology-esiliculosus
- Gene: Tiso_gene_8035
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-in-silico_annotation
Pathways
- PWY-7539, 6-hydroxymethyl-dihydropterin diphosphate biosynthesis III (Chlamydia): PWY-7539
- 4 reactions found over 5 reactions in the full pathway
- PWY-6168, flavin biosynthesis III (fungi): PWY-6168
- 6 reactions found over 9 reactions in the full pathway
- RIBOSYN2-PWY, flavin biosynthesis I (bacteria and plants): RIBOSYN2-PWY
- 7 reactions found over 9 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-athaliana
- Tool: pantograph
- Source: orthology-synechocystis
- Tool: pantograph
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-athaliana
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation
External links
- LIGAND-RXN:
- UNIPROT: