Difference between revisions of "UDP-OHMYR-ACETYLGLUCOSAMINE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=GUANOSINE GUANOSINE] == * smiles: ** C(O)C1(OC(C(O)C(O)1)N3(C=NC2(C(=O)NC(N)=NC=23))) * inchi k...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-OHMYR-ACETYLGLUCOSAMINE UDP-OHMYR-ACETYLGLUCOSAMINE] == * smiles: ** CCCCCCCCCCCC(CC(OC3(C(...") |
||
(2 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=UDP-OHMYR-ACETYLGLUCOSAMINE UDP-OHMYR-ACETYLGLUCOSAMINE] == |
* smiles: | * smiles: | ||
− | ** C(O) | + | ** CCCCCCCCCCCC(CC(OC3(C(C(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OC(C3O)CO)NC(=O)C))=O)O |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** UDP-3-O-[(3R)-3-hydroxymyristoyl]-N-acetyl-α-D-glucosamine |
+ | * inchi key: | ||
+ | ** InChIKey=TZSJGZGYQDNRRX-MPLCHSTDSA-L | ||
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 831.7 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** UDP-3-O-(3-hydroxytetradecanoyl)-N-acetylglucosamine |
+ | ** UDP-3-O-(3-hydroxymyristoyl)-N-acetylglucosamine | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | * [[ | + | * [[UDPACYLGLCNACDEACETYL-RXN]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
− | * [[ | + | * [[UDPNACETYLGLUCOSAMACYLTRANS-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25244942 25244942] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=61494 61494] |
− | * BIGG : | + | * BIGG : u3aga |
− | {{#set: smiles=C(O) | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04738 C04738] |
− | {{#set: | + | {{#set: smiles=CCCCCCCCCCCC(CC(OC3(C(C(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OC(C3O)CO)NC(=O)C))=O)O}} |
− | {{#set: molecular weight= | + | {{#set: common name=UDP-3-O-[(3R)-3-hydroxymyristoyl]-N-acetyl-α-D-glucosamine}} |
− | {{#set: common name= | + | {{#set: inchi key=InChIKey=TZSJGZGYQDNRRX-MPLCHSTDSA-L}} |
− | {{#set: consumed by= | + | {{#set: molecular weight=831.7 }} |
− | {{#set: produced by= | + | {{#set: common name=UDP-3-O-(3-hydroxytetradecanoyl)-N-acetylglucosamine|UDP-3-O-(3-hydroxymyristoyl)-N-acetylglucosamine}} |
+ | {{#set: consumed by=UDPACYLGLCNACDEACETYL-RXN}} | ||
+ | {{#set: produced by=UDPNACETYLGLUCOSAMACYLTRANS-RXN}} |
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite UDP-OHMYR-ACETYLGLUCOSAMINE
- smiles:
- CCCCCCCCCCCC(CC(OC3(C(C(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OC(C3O)CO)NC(=O)C))=O)O
- common name:
- UDP-3-O-[(3R)-3-hydroxymyristoyl]-N-acetyl-α-D-glucosamine
- inchi key:
- InChIKey=TZSJGZGYQDNRRX-MPLCHSTDSA-L
- molecular weight:
- 831.7
- Synonym(s):
- UDP-3-O-(3-hydroxytetradecanoyl)-N-acetylglucosamine
- UDP-3-O-(3-hydroxymyristoyl)-N-acetylglucosamine
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCCCCCCCCCCC(CC(OC3(C(C(OP(=O)([O-])OP(=O)([O-])OCC1(OC(C(O)C(O)1)N2(C=CC(=O)NC(=O)2)))OC(C3O)CO)NC(=O)C))=O)O" cannot be used as a page name in this wiki.
"UDP-3-O-[(3R)-3-hydroxymyristoyl]-N-acetyl-α-D-glucosamine" cannot be used as a page name in this wiki.