Difference between revisions of "PROTOHEME"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Holo-EntF Holo-EntF] == * common name: ** a holo-[EntF peptidyl-carrier protein] * Synonym(s):...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * smiles: ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(...") |
||
| (2 intermediate revisions by the same user not shown) | |||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == |
| + | * smiles: | ||
| + | ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8)))) | ||
* common name: | * common name: | ||
| − | ** | + | ** ferroheme b |
| + | * inchi key: | ||
| + | ** InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J | ||
| + | * molecular weight: | ||
| + | ** 614.482 | ||
* Synonym(s): | * Synonym(s): | ||
| + | ** protoheme IX | ||
| + | ** ferroprotoporphyrin IX | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| + | * [[HEME-OXYGENASE-DECYCLIZING-RXN]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | |||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[PROTOHEMEFERROCHELAT-RXN]] | ||
== External links == | == External links == | ||
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627] |
| + | * BIGG : pheme | ||
| + | {{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}} | ||
| + | {{#set: common name=ferroheme b}} | ||
| + | {{#set: inchi key=InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J}} | ||
| + | {{#set: molecular weight=614.482 }} | ||
| + | {{#set: common name=protoheme IX|ferroprotoporphyrin IX}} | ||
| + | {{#set: consumed by=HEME-OXYGENASE-DECYCLIZING-RXN}} | ||
| + | {{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}} | ||
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite PROTOHEME
- smiles:
- C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
- common name:
- ferroheme b
- inchi key:
- InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
- molecular weight:
- 614.482
- Synonym(s):
- protoheme IX
- ferroprotoporphyrin IX
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CHEBI:
- BIGG : pheme
"C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))" cannot be used as a page name in this wiki.
