Difference between revisions of "PROTOHEME"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14285 RXN-14285] == * direction: ** LEFT-TO-RIGHT * common name: ** thymidine_phosphorylase * e...")
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * smiles: ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(...")
 
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14285 RXN-14285] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
 
* common name:
 
* common name:
−
** thymidine_phosphorylase
+
** ferroheme b
−
* ec number:
+
* inchi key:
−
** [http://enzyme.expasy.org/EC/2.4.1.1 EC-2.4.1.1]
+
** InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
 +
* molecular weight:
 +
** 614.482   
 
* Synonym(s):
 
* Synonym(s):
 +
** protoheme IX
 +
** ferroprotoporphyrin IX
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
−
** 1 [[Pi]][c] '''+''' 1 [[MALTOHEXAOSE]][c] '''=>''' 1 [[GLC-1-P]][c] '''+''' 1 [[MALTOPENTAOSE]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 phosphate[c] '''+''' 1 maltohexaose[c] '''=>''' 1 α-D-glucopyranose 1-phosphate[c] '''+''' 1 maltopentaose[c]
+
* [[PROTOHEMEFERROCHELAT-RXN]]
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* Gene: [[Tiso_gene_1011]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Assignment: EC-NUMBER
+
−
== Pathways  ==
+
−
== Reconstruction information  ==
+
−
* Category: [[annotation]]
+
−
** Source: [[annotation-in-silico_annotation]]
+
−
*** Tool: [[pathwaytools]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* CHEBI:
−
{{#set: common name=thymidine_phosphorylase}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627]
−
{{#set: ec number=EC-2.4.1.1}}
+
* BIGG : pheme
−
{{#set: gene associated=Tiso_gene_1011}}
+
{{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}}
−
{{#set: in pathway=}}
+
{{#set: common name=ferroheme b}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: inchi key=InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J}}
−
{{#set: reconstruction source=annotation-in-silico_annotation}}
+
{{#set: molecular weight=614.482    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=protoheme IX|ferroprotoporphyrin IX}}
 +
{{#set: consumed by=HEME-OXYGENASE-DECYCLIZING-RXN}}
 +
{{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}}

Latest revision as of 19:59, 21 March 2018

Metabolite PROTOHEME

  • smiles:
    • C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
  • common name:
    • ferroheme b
  • inchi key:
    • InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
  • molecular weight:
    • 614.482
  • Synonym(s):
    • protoheme IX
    • ferroprotoporphyrin IX

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • CHEBI:
  • BIGG : pheme
"C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))" cannot be used as a page name in this wiki.




Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=PROTOHEME&oldid=45043"