Difference between revisions of "Tiso gene 1589"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] == * smiles: ** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(...")
(Created page with "Category:Gene == Gene Tiso_gene_1589 == * right end position: ** 11234 * transcription direction: ** POSITIVE * left end position: ** 10751 * centisome position: ** 46.658...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PROTOHEME PROTOHEME] ==
+
== Gene Tiso_gene_1589 ==
−
* smiles:
+
* right end position:
−
** C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))
+
** 11234
−
* inchi key:
+
* transcription direction:
−
** InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J
+
** POSITIVE
−
* common name:
+
* left end position:
−
** ferroheme b
+
** 10751
−
* molecular weight:
+
* centisome position:
−
** 614.482    
+
** 46.65828    
 
* Synonym(s):
 
* Synonym(s):
−
** protoheme IX
 
−
** ferroprotoporphyrin IX
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[HEME-OXYGENASE-DECYCLIZING-RXN]]
+
* Reaction: [[RXN-15556]]
−
== Reaction(s) known to produce the compound ==
+
** Source: [[annotation-in-silico_annotation]]
−
== Reaction(s) of unknown directionality ==
+
*** Assignment: ec-number
−
* [[PROTOHEMEFERROCHELAT-RXN]]
+
* Reaction: [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* CHEBI:
+
{{#set: right end position=11234}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17627 17627]
+
{{#set: transcription direction=POSITIVE}}
−
* BIGG : pheme
+
{{#set: left end position=10751}}
−
{{#set: smiles=C=CC1(C(C)=C7(C=C8(C(C)=C(CCC(=O)[O-])C6(=[N+]([Fe--]24(N(C=1C=C3(C(C)=C(C=C)C(=[N+]23)C=C5(C(C)=C(CCC(=O)[O-])C(N45)=C6)))7))8))))}}
+
{{#set: centisome position=46.65828   }}
−
{{#set: inchi key=InChIKey=KABFMIBPWCXCRK-RGGAHWMASA-J}}
+
{{#set: reaction associated=RXN-15556|UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: common name=ferroheme b}}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: molecular weight=614.482   }}
+
−
{{#set: common name=protoheme IX|ferroprotoporphyrin IX}}
+
−
{{#set: consumed by=HEME-OXYGENASE-DECYCLIZING-RXN}}
+
−
{{#set: reversible reaction associated=PROTOHEMEFERROCHELAT-RXN}}
+

Latest revision as of 19:59, 21 March 2018

Gene Tiso_gene_1589

  • right end position:
    • 11234
  • transcription direction:
    • POSITIVE
  • left end position:
    • 10751
  • centisome position:
    • 46.65828
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_1589&oldid=45045"