Difference between revisions of "MLTHFtm"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] == * smiles: ** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=MLTHFtm MLTHFtm] == * direction: ** REVERSIBLE * common name: ** 5,10-Methylenetetrahydrofolate upt...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=N-FORMYLKYNURENINE N-FORMYLKYNURENINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=MLTHFtm MLTHFtm] ==
* smiles:
+
* direction:
** [CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])
+
** REVERSIBLE
 
* common name:
 
* common name:
** N-formylkynurenine
+
** 5,10-Methylenetetrahydrofolate uptake carrier, mitochondria
* inchi key:
+
** InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N
+
* molecular weight:
+
** 236.227   
+
 
* Synonym(s):
 
* Synonym(s):
** N-Formyl-L-kynurenine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[ARYLFORMAMIDASE-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1.0 [[PROTON]][c] '''+''' 1.0 [[METHYLENE-THF]][c] '''<=>''' 1.0 [[PROTON]][m] '''+''' 1.0 [[METHYLENE-THF]][m]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1.0 H+[c] '''+''' 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] '''<=>''' 1.0 H+[m] '''+''' 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[m]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_19115]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-creinhardtii]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 1022-31-7
+
{{#set: direction=REVERSIBLE}}
* PUBCHEM:
+
{{#set: common name=5,10-Methylenetetrahydrofolate uptake carrier, mitochondria}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202092 25202092]
+
{{#set: gene associated=Tiso_gene_19115}}
* HMDB : HMDB60485
+
{{#set: in pathway=}}
* CHEBI:
+
{{#set: reconstruction category=orthology}}
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58629 58629]
+
{{#set: reconstruction source=orthology-creinhardtii}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C02700 C02700]
+
{{#set: smiles=[CH](=O)NC1(C=CC=CC=1C(=O)CC([N+])C(=O)[O-])}}
+
{{#set: common name=N-formylkynurenine}}
+
{{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-QMMMGPOBSA-N}}
+
{{#set: molecular weight=236.227    }}
+
{{#set: common name=N-Formyl-L-kynurenine}}
+
{{#set: consumed by=ARYLFORMAMIDASE-RXN}}
+

Latest revision as of 20:59, 21 March 2018

Reaction MLTHFtm

  • direction:
    • REVERSIBLE
  • common name:
    • 5,10-Methylenetetrahydrofolate uptake carrier, mitochondria
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1.0 H+[c] + 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[c] <=> 1.0 H+[m] + 1.0 5,10-methylenetetrahydropteroyl mono-L-glutamate[m]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links