Difference between revisions of "DTDP-DEOH-DEOXY-MANNOSE"
From metabolic_network
(Created page with "Category:Gene == Gene Tiso_gene_2144 == * left end position: ** 11081 * transcription direction: ** POSITIVE * right end position: ** 11828 * centisome position: ** 49.426...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-MANNOSE DTDP-DEOH-DEOXY-MANNOSE] == * smiles: ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C...") |
||
(3 intermediate revisions by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DTDP-DEOH-DEOXY-MANNOSE DTDP-DEOH-DEOXY-MANNOSE] == |
− | * | + | * smiles: |
− | ** | + | ** CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3)) |
− | * | + | * common name: |
− | ** | + | ** dTDP-4-dehydro-β-L-rhamnose |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=PSXWNITXWWECNY-LPVGZGSHSA-L |
− | * | + | * molecular weight: |
− | ** | + | ** 544.302 |
* Synonym(s): | * Synonym(s): | ||
+ | ** dTDP-4-oxo-6-deoxy-β-L-mannose | ||
+ | ** dTDP-4-oxo-β-L-rhamnose | ||
+ | ** dTDP-4-dehydro-6-deoxy-β-L-mannose | ||
+ | ** dTDP-4-keto-L-rhamnose | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[DTDPDEHYRHAMREDUCT-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=53356769 53356769] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62830 62830] |
− | {{#set: | + | * BIGG : dtdp4d6dm |
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00688 C00688] | ||
+ | {{#set: smiles=CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))}} | ||
+ | {{#set: common name=dTDP-4-dehydro-β-L-rhamnose}} | ||
+ | {{#set: inchi key=InChIKey=PSXWNITXWWECNY-LPVGZGSHSA-L}} | ||
+ | {{#set: molecular weight=544.302 }} | ||
+ | {{#set: common name=dTDP-4-oxo-6-deoxy-β-L-mannose|dTDP-4-oxo-β-L-rhamnose|dTDP-4-dehydro-6-deoxy-β-L-mannose|dTDP-4-keto-L-rhamnose}} | ||
+ | {{#set: consumed by=DTDPDEHYRHAMREDUCT-RXN}} |
Latest revision as of 19:59, 21 March 2018
Contents
Metabolite DTDP-DEOH-DEOXY-MANNOSE
- smiles:
- CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))
- common name:
- dTDP-4-dehydro-β-L-rhamnose
- inchi key:
- InChIKey=PSXWNITXWWECNY-LPVGZGSHSA-L
- molecular weight:
- 544.302
- Synonym(s):
- dTDP-4-oxo-6-deoxy-β-L-mannose
- dTDP-4-oxo-β-L-rhamnose
- dTDP-4-dehydro-6-deoxy-β-L-mannose
- dTDP-4-keto-L-rhamnose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC1(=CN(C(=O)NC(=O)1)C3(CC(O)C(COP(=O)([O-])OP(=O)([O-])OC2(OC(C)C(=O)C(O)C(O)2))O3))" cannot be used as a page name in this wiki.