Difference between revisions of "RXN-15740"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLCHOLINE ACETYLCHOLINE] == * smiles: ** CC(=O)OCC[N+](C)(C)C * common name: ** acetylcholi...")
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15740 RXN-15740] == * direction: ** LEFT-TO-RIGHT * ec number: ** [http://enzyme.expasy.org/EC/...")
 
Line 1: Line 1:
[[Category:Metabolite]]
+
[[Category:Reaction]]
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACETYLCHOLINE ACETYLCHOLINE] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15740 RXN-15740] ==
* smiles:
+
* direction:
** CC(=O)OCC[N+](C)(C)C
+
** LEFT-TO-RIGHT
* common name:
+
* ec number:
** acetylcholine
+
** [http://enzyme.expasy.org/EC/1.1.5.3 EC-1.1.5.3]
* inchi key:
+
** InChIKey=OIPILFWXSMYKGL-UHFFFAOYSA-N
+
* molecular weight:
+
** 146.209   
+
 
* Synonym(s):
 
* Synonym(s):
** Ach
 
** O-acetylcholine
 
  
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
* [[ACETYLCHOLINESTERASE-RXN]]
+
* With identifiers:
== Reaction(s) known to produce the compound ==
+
** 1 [[Menaquinones]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''=>''' 1 [[DIHYDROXY-ACETONE-PHOSPHATE]][c] '''+''' 1 [[Menaquinols]][c]
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 a menaquinone[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''=>''' 1 glycerone phosphate[c] '''+''' 1 a menaquinol[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* Gene: [[Tiso_gene_15777]]
 +
** Source: [[orthology-esiliculosus]]
 +
== Pathways  ==
 +
* [[PWY0-1582]], glycerol-3-phosphate to fumarate electron transfer: [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1582 PWY0-1582]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
* [[PWY0-1581]], nitrate reduction IX (dissimilatory): [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1581 PWY0-1581]
 +
** '''1''' reactions found over '''2''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[orthology]]
 +
** Source: [[orthology-esiliculosus]]
 +
*** Tool: [[pantograph]]
 
== External links  ==
 
== External links  ==
* CAS : 51-84-3
+
{{#set: direction=LEFT-TO-RIGHT}}
* Wikipedia : Acetylcholine
+
{{#set: ec number=EC-1.1.5.3}}
* DRUGBANK : DB03128
+
{{#set: gene associated=Tiso_gene_15777}}
* PUBCHEM:
+
{{#set: in pathway=PWY0-1582|PWY0-1581}}
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=187 187]
+
{{#set: reconstruction category=orthology}}
* HMDB : HMDB00895
+
{{#set: reconstruction source=orthology-esiliculosus}}
* LIGAND-CPD:
+
{{#set: reconstruction tool=pantograph}}
** [http://www.genome.jp/dbget-bin/www_bget?C01996 C01996]
+
* CHEMSPIDER:
+
** [http://www.chemspider.com/Chemical-Structure.182.html 182]
+
* CHEBI:
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=15355 15355]
+
* METABOLIGHTS : MTBLC15355
+
{{#set: smiles=CC(=O)OCC[N+](C)(C)C}}
+
{{#set: common name=acetylcholine}}
+
{{#set: inchi key=InChIKey=OIPILFWXSMYKGL-UHFFFAOYSA-N}}
+
{{#set: molecular weight=146.209    }}
+
{{#set: common name=Ach|O-acetylcholine}}
+
{{#set: consumed by=ACETYLCHOLINESTERASE-RXN}}
+

Latest revision as of 19:59, 21 March 2018

Reaction RXN-15740

  • direction:
    • LEFT-TO-RIGHT
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY0-1582, glycerol-3-phosphate to fumarate electron transfer: PWY0-1582
    • 1 reactions found over 2 reactions in the full pathway
  • PWY0-1581, nitrate reduction IX (dissimilatory): PWY0-1581
    • 1 reactions found over 2 reactions in the full pathway

Reconstruction information

External links