Difference between revisions of "RXN-22"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=TREHALOSE TREHALOSE] == * smiles: ** C(C1(OC(C(C(C1O)O)O)OC2(C(C(C(C(O2)CO)O)O)O)))O * inchi ke...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-22 RXN-22] == * direction: ** LEFT-TO-RIGHT * common name: ** argininosuccinate_lyase * ec numb...") |
||
(One intermediate revision by the same user not shown) | |||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-22 RXN-22] == |
− | * | + | * direction: |
− | ** | + | ** LEFT-TO-RIGHT |
− | + | ||
− | + | ||
* common name: | * common name: | ||
− | ** | + | ** argininosuccinate_lyase |
− | * | + | * ec number: |
− | ** | + | ** [http://enzyme.expasy.org/EC/4.3.2.1 EC-4.3.2.1] |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | == Reaction(s) | + | == Reaction Formula == |
− | * [[ | + | * With identifiers: |
− | == | + | ** 1 [[CANAVANINOSUCCINATE]][c] '''=>''' 1 [[CANAVANINE]][c] '''+''' 1 [[FUM]][c] |
− | * [[ | + | * With common name(s): |
− | == | + | ** 1 canavaninosuccinate[c] '''=>''' 1 L-canavanine[c] '''+''' 1 fumarate[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * Gene: [[Tiso_gene_2485]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: EC-NUMBER | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | == Pathways == | ||
+ | * [[PWY-5]], canavanine biosynthesis: [http://metacyc.org/META/NEW-IMAGE?object=PWY-5 PWY-5] | ||
+ | ** '''2''' reactions found over '''4''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | + | {{#set: common name=argininosuccinate_lyase}} | |
− | + | {{#set: ec number=EC-4.3.2.1}} | |
− | + | {{#set: gene associated=Tiso_gene_2485}} | |
− | + | {{#set: in pathway=PWY-5}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-in-silico_annotation|annotation-experimental_annotation|orthology-esiliculosus}} | |
− | + | {{#set: reconstruction tool=pantograph|pathwaytools}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:59, 21 March 2018
Contents
Reaction RXN-22
- direction:
- LEFT-TO-RIGHT
- common name:
- argininosuccinate_lyase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 CANAVANINOSUCCINATE[c] => 1 CANAVANINE[c] + 1 FUM[c]
- With common name(s):
- 1 canavaninosuccinate[c] => 1 L-canavanine[c] + 1 fumarate[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Gene: Tiso_gene_2485
- Source: annotation-in-silico_annotation
- Assignment: EC-NUMBER
- Source: annotation-experimental_annotation
- Assignment: EC-NUMBER
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
Pathways
Reconstruction information
- Category: orthology
- Source: orthology-esiliculosus
- Tool: pantograph
- Source: orthology-esiliculosus
- Category: annotation
- Source: annotation-in-silico_annotation
- Tool: pathwaytools
- Source: annotation-experimental_annotation
- Tool: pathwaytools
- Source: annotation-in-silico_annotation