Difference between revisions of "Tiso gene 12535"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] == * smiles: ** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2)) * inchi key: ** InChIKey=B...")
(Created page with "Category:Gene == Gene Tiso_gene_12535 == * right end position: ** 6667 * transcription direction: ** POSITIVE * left end position: ** 3578 * centisome position: ** 51.7575...")
 
(One intermediate revision by the same user not shown)
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-3187 CPD-3187] ==
+
== Gene Tiso_gene_12535 ==
−
* smiles:
+
* right end position:
−
** C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))
+
** 6667
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O
+
** POSITIVE
−
* common name:
+
* left end position:
−
** 2'-hydroxynicotine
+
** 3578
−
* molecular weight:
+
* centisome position:
−
** 179.241    
+
** 51.757557    
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* Reaction: [[4.3.1.17-RXN]]
−
* [[RXN66-146]]
+
** Source: [[orthology-synechocystis]]
−
== Reaction(s) of unknown directionality ==
+
** Source: [[orthology-creinhardtii]]
 +
* Reaction: [[RXN-15122]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-esiliculosus]]
 +
* Reaction: [[THREDEHYD-RXN]]
 +
** Source: [[annotation-in-silico_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[annotation-experimental_annotation]]
 +
*** Assignment: ec-number
 +
** Source: [[orthology-athaliana]]
 +
** Source: [[orthology-synechocystis]]
 +
** Source: [[orthology-esiliculosus]]
 +
** Source: [[orthology-creinhardtii]]
 +
== Pathways associated ==
 +
* [[PWY66-428]]
 +
* [[ILEUSYN-PWY]]
 +
* [[PWY-5826]]
 +
* [[PWY-5437]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: right end position=6667}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245599 25245599]
+
{{#set: transcription direction=POSITIVE}}
−
* HMDB : HMDB01329
+
{{#set: left end position=3578}}
−
{{#set: smiles=C1(CCC(O)([N+](C)1)C2(=CN=CC=C2))}}
+
{{#set: centisome position=51.757557    }}
−
{{#set: inchi key=InChIKey=BOQRPPFUUSHFGW-SNVBAGLBSA-O}}
+
{{#set: reaction associated=4.3.1.17-RXN|RXN-15122|THREDEHYD-RXN}}
−
{{#set: common name=2'-hydroxynicotine}}
+
{{#set: pathway associated=PWY66-428|ILEUSYN-PWY|PWY-5826|PWY-5437}}
−
{{#set: molecular weight=179.241    }}
+
−
{{#set: produced by=RXN66-146}}
+

Latest revision as of 19:59, 21 March 2018

Gene Tiso_gene_12535

  • right end position:
    • 6667
  • transcription direction:
    • POSITIVE
  • left end position:
    • 3578
  • centisome position:
    • 51.757557
  • Synonym(s):

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/tisogem/index.php?title=Tiso_gene_12535&oldid=45092"