Difference between revisions of "Tiso gene 12535"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11497 CPD-11497] == * smiles: ** COC1(=C(O)C=CC(C(O)CO)=C1) * common name: ** 3-methoxy-4-h...") |
(Created page with "Category:Gene == Gene Tiso_gene_12535 == * right end position: ** 6667 * transcription direction: ** POSITIVE * left end position: ** 3578 * centisome position: ** 51.7575...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Tiso_gene_12535 == |
− | * | + | * right end position: |
− | ** | + | ** 6667 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * left end position: |
− | ** | + | ** 3578 |
− | * | + | * centisome position: |
− | ** | + | ** 51.757557 |
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | |||
− | == | + | == Reactions associated == |
− | + | * Reaction: [[4.3.1.17-RXN]] | |
− | == | + | ** Source: [[orthology-synechocystis]] |
− | * [[ | + | ** Source: [[orthology-creinhardtii]] |
+ | * Reaction: [[RXN-15122]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | * Reaction: [[THREDEHYD-RXN]] | ||
+ | ** Source: [[annotation-in-silico_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[annotation-experimental_annotation]] | ||
+ | *** Assignment: ec-number | ||
+ | ** Source: [[orthology-athaliana]] | ||
+ | ** Source: [[orthology-synechocystis]] | ||
+ | ** Source: [[orthology-esiliculosus]] | ||
+ | ** Source: [[orthology-creinhardtii]] | ||
+ | == Pathways associated == | ||
+ | * [[PWY66-428]] | ||
+ | * [[ILEUSYN-PWY]] | ||
+ | * [[PWY-5826]] | ||
+ | * [[PWY-5437]] | ||
== External links == | == External links == | ||
− | + | {{#set: right end position=6667}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: left end position=3578}} | |
− | + | {{#set: centisome position=51.757557 }} | |
− | + | {{#set: reaction associated=4.3.1.17-RXN|RXN-15122|THREDEHYD-RXN}} | |
− | + | {{#set: pathway associated=PWY66-428|ILEUSYN-PWY|PWY-5826|PWY-5437}} | |
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Latest revision as of 20:59, 21 March 2018
Gene Tiso_gene_12535
- right end position:
- 6667
- transcription direction:
- POSITIVE
- left end position:
- 3578
- centisome position:
- 51.757557
- Synonym(s):
Reactions associated
- Reaction: 4.3.1.17-RXN
- Source: orthology-synechocystis
- Source: orthology-creinhardtii
- Reaction: RXN-15122
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-esiliculosus
- Source: annotation-in-silico_annotation
- Reaction: THREDEHYD-RXN
- Source: annotation-in-silico_annotation
- Assignment: ec-number
- Source: annotation-experimental_annotation
- Assignment: ec-number
- Source: orthology-athaliana
- Source: orthology-synechocystis
- Source: orthology-esiliculosus
- Source: orthology-creinhardtii
- Source: annotation-in-silico_annotation